
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 64123-77-9 |
| Catalog No. | 2A-9068702 |
| Chinese Name | 3-氟苯乙酸甲酯 |
| Synonyms | methyl 2-(3-fluorophenyl)acetate |
| Molecular Formula | C9H9O2F1 |
| Molecular Weight | 168.17 |
| Density | 1.148g/cm3 |
| Boiling Point | 204ºC at 760 mmHg |
| Appearance | Liquid | Clear colorless to slightly yellow |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2916399090 |
| MDL Number | MFCD03093288 |
| SMILES | COC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C9H9FO2/c1-12-9(11)6-7-3-2-4-8(10)5-7/h2-5H,6H2,1H3 |
| InChI Key | OXYLCGRXCQARQV-UHFFFAOYSA-N |
| MSDS | msds/68702_1_64123_77_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,3-dibromo-2-chlorobenzene | 19230-27-4 | 2A-9068696 |
| Nodosin | 10391-09-0 | 2A-9068698 |
| 3-Fluoro-5-iodobenzotrifluoride | 1027513-14-9 | 2A-9068699 |
| Ethyl2-fluorobenzoylformate | 1813-93-0 | 2A-9068700 |
| Butein | 487-52-5 | 2A-9068701 |
| 5-Bromo-4-isopropyl-2-aminobenzoicmethylester | 1000018-13-2 | 2A-9068703 |
| 3-Bromo-5-chloroaniline? | 96558-78-0 | 2A-9068704 |
| Seneganolide | 301530-12-1 | 2A-9068705 |
| N-(2-oxo-2-phenylethyl)benzamide | 4190-14-1 | 2A-9068706 |
| 4-Bromo-3,5-dichlorofluorobenzene | 263333-82-0 | 2A-9068707 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA