
CAS Number93-39-0
Synonyms7-(Glucosyloxy)coumarin; Skimmin; 7-Hydroxycoumarin-7-glucoside; Skimmine; UMBELLIFERONE GLUCOSIDE; 2-Oxo-2H-chromen-7-yl β-D-glucopyranoside; HYDROXYCOUMARIN-GLUCOSIDE,7; 7-(b-D-Glucopyranosyloxy)-2H-1-benzopyran-2-one
Molecular FormulaC15H16O8
Molecular Weight324.29
Density1.6±0.1 g/cm3
Boiling Point632.0±55.0 °C at 760 mmHg
Melting Point221-222ºC
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 93-39-0 |
| Catalog No. | 2A-9068680 |
| Chinese Name | 茵芋苷 |
| Synonyms | 7-(Glucosyloxy)coumarin; Skimmin; 7-Hydroxycoumarin-7-glucoside; Skimmine; UMBELLIFERONE GLUCOSIDE; 2-Oxo-2H-chromen-7-yl β-D-glucopyranoside; HYDROXYCOUMARIN-GLUCOSIDE,7; 7-(b-D-Glucopyranosyloxy)-2H-1-benzopyran-2-one |
| Molecular Formula | C15H16O8 |
| Molecular Weight | 324.29 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 632.0±55.0 °C at 760 mmHg |
| Melting Point | 221-222ºC |
| Appearance | white powder |
| Storage Condition | room temperature |
| Application | Skimmin (Umbelliferone glucoside) is a coumarin substance present in Hydrangea paniculata, which can inhibit the deposition of immune complexes and has anti-inflammatory activity. |
| MDL Number | C15H16O8 |
| SMILES | O=c1ccc2ccc(OC3OC(CO)C(O)C(O)C3O)cc2o1 |
| InChI | InChI=1S/C15H16O8/c16-6-10-12(18)13(19)14(20)15(23-10)21-8-3-1-7-2-4-11(17)22-9(7)5-8/h1-5,10,12-16,18-20H,6H2 |
| InChI Key | VPAOSFFTKWUGAD-TVKJYDDYSA-N |
| MSDS | msds/68680_1_93_39_0.pdf |
| Transport Info | Product Name: Inioside |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| (3R)-Hydrangenol8-O-glucosidepentaacetate | 113270-98-7 | 2A-9068298 |
| (3S)-Hydrangenol8-O-glucosidepentaacetate | 113270-99-8 | 2A-9068301 |
| p-VinylphenylO-[beta-D-apiofuranosyl-(1-6)]-beta-D-glucopyranoside | 112047-91-3 | 2A-9068315 |
| Apigenin4'-O-rhamnoside | 133538-77-9 | 2A-9068383 |
| Fraxiresinol1-O-glucoside | 89199-94-0 | 2A-9068666 |
| 2',4'-Dihydroxy-3',6'-dimethoxydihydrochalcone | 54299-52-4 | 2A-9068763 |
| Dihydroresveratrol3-O-glucoside | 100432-87-9 | 2A-9068782 |
| Agrimonolide6-O-glucoside | 126223-29-8 | 2A-9068937 |
| Hydroxygenkwanin | 20243-59-8 | 2A-9068946 |
| 5,5'-Dimethoxylariciresinol4-O-glucoside | 154418-16-3 | 2A-9068986 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA