
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 97271-97-1 |
| Catalog No. | 2A-9068659 |
| Chinese Name | 2-氨基-3-硝基-苯甲醛 |
| Synonyms | 2-Amino-3-nitro-benzaldehyde; Benzaldehyde,2-amino-3-nitro; 2-Amino-3-nitrobenzaldehyde |
| Molecular Formula | C7H6N2O3 |
| Molecular Weight | 166.134 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 335.8±32.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, stored in inert gas |
| HTC | 2922399090 |
| SMILES | Nc1c(C=O)cccc1[N+](=O)[O-] |
| InChI Key | LDKGAMZVANIDGZ-UHFFFAOYSA-N |
| MSDS | msds/68659_1_97271_97_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Chloro-3-nitrophenylboronicacid | 151169-67-4 | 2A-9068618 |
| p-(4-propylcyclohexyl)phenylboronicacid | 156837-90-0 | 2A-9068619 |
| 4-(dimethylamino)-3-methylbenzaldehyde | 1424-69-7 | 2A-9068648 |
| 2-Chloro-4-bromobenzaldehyde | 158435-41-7 | 2A-9068650 |
| 2-Chloro-3-nitrobenzaldehyde | 58755-57-0 | 2A-9068652 |
| 3,6-difluoro-2-hydroxybenzaldehyde | 502762-92-7 | 2A-9068683 |
| 1-[(chloromethyl)sulfonyl]naphthalene | 87491-79-0 | 2A-9068712 |
| 4-(t-Butoxycarbonyl)phenylboronicacid | 850568-54-6 | 2A-9068722 |
| 2-(4-hydroxy-3-methoxyphenyl)acetaldehyde | 5703-24-2 | 2A-9068727 |
| (2-fluoro-3-methyl-6-(trifluoromethyl)phenyl)hydrazine | 927901-61-9 | 2A-9068768 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA