
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 756469-30-4 |
| Catalog No. | 2A-9068639 |
| Chinese Name | 4-(2-硫乙基)苯甲酸 1-甲酯 |
| Synonyms | A9618; 2-(4-(methoxycarbonyl)phenyl)ethanesulfonic acid; 2-(2-BROMOPHENYL)THIAZOLE-4-CARBALDEHYDE |
| Molecular Formula | C17H23O4N2Cl1 |
| Molecular Weight | 244.26400 |
| HTC | 2914700090 |
| MDL Number | MFCD18651754 |
| SMILES | Clc1c(ccc(c1)C(=O)OC)N2CCN(CC2)C(=O)OC(C)(C)C |
| InChI | 1S/C17H23ClN2O4/c1-17(2,3)24-16(22)20-9-7-19(8-10-20)14-6-5-12(11-13(14)18)15(21)23-4/h5-6,11H,7-10H2,1-4H3 |
| InChI Key | OQYMMYYTJXVHSU-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352100 |
| MSDS | msds/68639_1_756469_30_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(3-hydroxypropyl)benzonitrile | 83101-12-6 | 2A-9068634 |
| methyl4-(3-bromopropyl)benzoate | 113100-86-0 | 2A-9068635 |
| 3-(4-(methoxycarbonyl)phenyl)propane-1-sulfonicacid | 1223748-39-7 | 2A-9068636 |
| 4-(2-hydroxyethyl)benzonitrile | 69395-13-7 | 2A-9068637 |
| methyl4-(2-bromoethyl)benzoate | 36333-97-6 | 2A-9068638 |
| 2-(2-cyanophenyl)ethanesulfonicacid | 1223748-51-3 | 2A-9068640 |
| 2-(2-hydroxyethyl)benzonitrile | 42247-74-5 | 2A-9068641 |
| (6-chlorobenzo[d][1,3]dioxol-5-yl)methanamine | 558453-64-8 | 2A-9068643 |
| tert-butyl4-nitrophenylcarbamate | 18437-63-3 | 2A-9068646 |
| 3-chloro-6-hydroxy-2-methoxybenzoicacid | 146984-79-4 | 2A-9068647 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA