CAS Number136496-72-5
Synonyms4-borono-2-chlorobenzoic acid; 2-Chloro-4-(dihydroxyboranyl)benzoic acid; 4-Carboxy-3-chlorobenzeneboronic acid; 2-Chloro-4-(dihydroxyboryl)benzoic acid; 3-Chloro-4-carboxyphenylboronic acid; MFCD06656268; 4-CARBOXY-3-CHLOROPHENYLBORONIC ACID
Molecular FormulaC7H6BClO4
Molecular Weight200.38
Density1.6±0.1 g/cm3
Boiling Point429.2±55.0 °C at 760 mmHg
Melting Point236-238
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 136496-72-5 |
| Catalog No. | 2A-9068609 |
| Chinese Name | 4-羧基-3-氯苯硼酸 |
| Synonyms | 4-borono-2-chlorobenzoic acid; 2-Chloro-4-(dihydroxyboranyl)benzoic acid; 4-Carboxy-3-chlorobenzeneboronic acid; 2-Chloro-4-(dihydroxyboryl)benzoic acid; 3-Chloro-4-carboxyphenylboronic acid; MFCD06656268; 4-CARBOXY-3-CHLOROPHENYLBORONIC ACID |
| Molecular Formula | C7H6BClO4 |
| Molecular Weight | 200.38 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 429.2±55.0 °C at 760 mmHg |
| Melting Point | 236-238 |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2931900090 |
| PubChem ID | 329774469 |
| MDL Number | MFCD06656268 |
| SMILES | OB(C1=CC=C(C(O)=O)C(Cl)=C1)O |
| InChI | 1S/C7H6BClO4/c9-6-3-4(8(12)13)1-2-5(6)7(10)11/h1-3,12-13H,(H,10,11) |
| InChI Key | QFAFGWXQNDYXPZ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/68609_1_136496_72_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Fluoro-4-methoxyphenylboronicacid | 162101-31-7 | 2A-9068604 |
| 2-Fluoro-5-(trifluoromethoxy)phenylboronicacid | 881402-22-8 | 2A-9068605 |
| 3-Chloro-4-(trifluoromethyl)phenylboronicacid | 847756-88-1 | 2A-9068606 |
| 2-Bromo-4-(trifluoromethyl)phenylboronicacid | 959997-88-7 | 2A-9068607 |
| 2,3-Dichlorophenylboronicacid | 151169-74-3 | 2A-9068608 |
| 3-Bromophenylboronicacid | 89598-96-9 | 2A-9068610 |
| 5-Fluoro-2-methylphenylboronicacid | 163517-62-2 | 2A-9068612 |
| 4-Fluoro-2-methylphenylboronicacid | 139911-29-8 | 2A-9068613 |
| 2,3-Dimethylphenylboronicacid | 183158-34-1 | 2A-9068614 |
| 3,5-Dimethoxyphenylboronicacid | 192182-54-0 | 2A-9068616 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS