
CAS Number480-23-9
Synonyms3-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one; 5,7,3',4'-Tetrahydroxyisoflavone; 3'-hydroxygenistein; Orobol; Norsantal; 3',4',5,7-tetrahydroxyisoflavone; Santol; 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one; Isoluteolin
Molecular FormulaC15H10O6
Molecular Weight286.24
Density1.7±0.1 g/cm3
Boiling Point616.1±55.0 °C at 760 mmHg
Appearanceyellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 480-23-9 |
| Catalog No. | 2A-9068376 |
| Chinese Name | 奥洛波尔 |
| Synonyms | 3-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one; 5,7,3',4'-Tetrahydroxyisoflavone; 3'-hydroxygenistein; Orobol; Norsantal; 3',4',5,7-tetrahydroxyisoflavone; Santol; 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one; Isoluteolin |
| Molecular Formula | C15H10O6 |
| Molecular Weight | 286.24 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 616.1±55.0 °C at 760 mmHg |
| Appearance | yellow powder |
| Storage Condition | 2-8℃, dry, sealed |
| Application | Orobol is a major soy isoflavone with multiple pharmacological activities, including anti-skin aging and anti-obesity effects. Orobol inhibits CK1ε, VEGFR2, MAP4K5, MNK1, Musk, TOPK and TNIK (IC50=1.2 |
| MDL Number | C15H10O6 |
| SMILES | O=c1c(-c2ccc(O)c(O)c2)coc2cc(O)cc(O)c12 |
| InChI Key | IOYHCQBYQJQBSK-UHFFFAOYSA-N |
| MSDS | msds/68376_1_480_23_9.pdf |
| Transport Info | Product Name: Orobol |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(1H-1,2,4-Triazol-1-yl)benzoicacid | 162848-16-0 | 2A-9068370 |
| PaxiphyllineD | 1092555-02-6 | 2A-9068371 |
| 6-Morpholinonicotinicacid | 120800-52-4 | 2A-9068372 |
| 5,6-Dihydro-4H-pyran-2-carboxylicacid | 31518-14-6 | 2A-9068373 |
| Cabraleahydroxylactoneacetate | 35833-70-6 | 2A-9068375 |
| 3,4-Dihydro-3,4-dihydroxynaphthalen-1(2H)-one | 1220891-22-4 | 2A-9068377 |
| 9-Hydroxy-alpha-lapachone | 22333-58-0 | 2A-9068378 |
| 3,4-Dihydro-2,2-dimethyl-2H-naphtho[1,2-b]pyran | 16274-33-2 | 2A-9068379 |
| 1-Hydroxy-2-prenylnaphthalene | 16274-34-3 | 2A-9068380 |
| 1-O-Deacetyl-2alpha-hydroxykhayanolideE | 1189801-51-1 | 2A-9068381 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA