
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 99970-84-0 |
| Catalog No. | 2A-9067903 |
| Chinese Name | 2,2'-双吡啶-4,4'-二甲醛 |
| Synonyms | 2-(4-formylpyridin-2-yl)pyridine-4-carbaldehyde; MFCD00667770 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 272.26 |
| Purity | ≥98.0 (HPLC) |
| Density | 1.289g/cm3 |
| Boiling Point | 434.4ºC at 760 mmHg |
| Melting Point | 208-212 °C |
| Appearance | powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933399090 |
| PubChem ID | 329765576 |
| MDL Number | MFCD02669916 |
| SMILES | COC(=O)c1ccnc(c1)-c2cc(ccn2)C(=O)OC |
| InChI | 1S/C14H12N2O4/c1-19-13(17)9-3-5-15-11(7-9)12-8-10(4-6-16-12)14(18)20-2/h3-8H,1-2H3 |
| InChI Key | HBWBVIDKBKOVEX-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/67903_1_99970_84_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3,5-di(benzo(d)oxazol-2-yl)pyridine | 1223748-38-6 | 2A-9067897 |
| 2-Amino-4-bromopyridine | 84749-14-9 | 2A-9067898 |
| 2-tert-butylpyridine | 5944-41-2 | 2A-9067899 |
| 5-bromo-2-tert-butylpyridine | 39919-58-9 | 2A-9067900 |
| 2-(benzyloxy)-5-methylpyridine | 92028-39-2 | 2A-9067902 |
| 5-ethynyl-2-fluoropyridine | 853909-08-7 | 2A-9067906 |
| 5-ethynyl-2-methoxypyridine | 663955-59-7 | 2A-9067907 |
| 2-(bromomethyl)-4-methoxy-3,5-dimethylpyridine | 780752-32-1 | 2A-9067913 |
| 4-(hydrazinylmethyl)-2-methylpyridine | 1223748-30-8 | 2A-9067917 |
| 5-Bromo-2-(2-methyl-2H-tetrazol-5-yl)-pyridine | 380380-64-3 | 2A-9067923 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA