
CAS Number93102-05-7
SynonymsN-(methoxymethyl)-1-phenyl-N-(trimethylsilylmethyl)methanamine; N-Benzyl-1-methoxy-N-[(trimethylsilyl)methyl]methanamine; MFCD00674005; N-(Methoxymethyl)-N-[(trimethylsilyl-methyl]-benzylamine
Molecular FormulaC13H23NOSi
Molecular Weight237.413
Density0.9±0.1 g/cm3
Boiling Point248.7±20.0 °C at 760 mmHg
AppearanceTransparent colorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 93102-05-7 |
| Catalog No. | 2A-0202118 |
| Chinese Name | N-(甲氧甲基)-N-(三甲基硅甲基)苄胺 |
| Synonyms | N-(methoxymethyl)-1-phenyl-N-(trimethylsilylmethyl)methanamine; N-Benzyl-1-methoxy-N-[(trimethylsilyl)methyl]methanamine; MFCD00674005; N-(Methoxymethyl)-N-[(trimethylsilyl-methyl]-benzylamine |
| Molecular Formula | C13H23NOSi |
| Molecular Weight | 237.413 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 248.7±20.0 °C at 760 mmHg |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Refrigerated, airtight, dry place |
| HTC | 2931900090 |
| SMILES | COCN(Cc1ccccc1)C[Si](C)(C)C |
| InChI Key | RPZAAFUKDPKTKP-UHFFFAOYSA-N |
| MSDS | msds/67819_2_93102_05_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 90.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Semiconductor Chemical Intermediates | ||
|---|---|---|
| Trisilane, 1,1,1,3,3,3-hexamethyl-2-(trimethylsilyl)- | 1873-77-4 | 2A-9062676 |
| cis-4-Exo-Isopropenyl-1,9-dimethyl-8-(trimethylsilyl)bicyclo[4.3.0]non-8-en-2-one | 77494-23-6 | 2A-9063809 |
| 1-tert-Butyldimethylsilyloxy-2-methyl-1-cyclohexene | 20152-33-4 | 2A-9064196 |
| Diethyl trans-4-trimethylsilyloxy-4-cyclohexene-1,2-dicarboxylate | 61692-31-7 | 2A-9065074 |
| (Trimethylsilyl)methyl carbamate | 3124-45-6 | 2A-9067468 |
| Thexyltrichlorosilane | 18151-53-6 | 2A-9068750 |
| 1-(tert-butyldimethylsilyl)-1H-indol-4-yl-4-boronicacid | 351457-64-2 | 2A-9069273 |
| 1-(tert-butyldimethylsilyl)-1H-indol-5-yl-5-boronicacid | 913835-68-4 | 2A-9069274 |
| 1-(tert-butyldimethylsilyl)-1H-indol-6-yl-6-boronicacid | 913835-60-6 | 2A-9069277 |
| 1-(tert-butyldimethylsilyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole | 1111096-51-5 | 2A-9069279 |
| Browse all Semiconductor Chemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA