Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 62218-55-7 |
| Catalog No. | 2A-9067773 |
| Chinese Name | 4-羟基-2,6,6-三甲基-1-环己烯羧酸 |
| Synonyms | 4-Hydroxy-2,6,6-trimethyl-1-cyclohexene-1-carboxylic acid |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 264.32 |
| Purity | ≥98.0 (HPLC) |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 318.7±42.0 °C at 760 mmHg |
| Appearance | crystal |
| Storage Condition | 2-8℃, dry, sealed |
| EINECS | 244-319-5 |
| HTC | 2918199090 |
| PubChem ID | 329769948 |
| MDL Number | MFCD00066545 |
| SMILES | CC(\C=C\[C@@]1(O)C(C)=CC(=O)CC1(C)C)=C\C(O)=O |
| InChI | 1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7-/t15-/m1/s1 |
| InChI Key | JLIDBLDQVAYHNE-YKALOCIXSA-N |
| Beilstein/REAXYS | 2698956 |
| NACRES Code | NA.24 |
| UNSPSC | 12352106 |
| MSDS | msds/67773_1_62218_55_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(1H-Pyrrol-1-yl)aniline | 89353-42-4 | 2A-9067749 |
| 4,5-Dibromo-2-phenyl-3(2H)-pyridazinone | 14305-08-9 | 2A-9067753 |
| 3-[(3-Morpholinopropyl)amino]propionitrile | 102440-39-1 | 2A-9067755 |
| 2-Propynylurea | 5221-62-5 | 2A-9067767 |
| 3,5-dimethylpyrazin-2-amine | 91678-81-8 | 2A-9067768 |
| 3-Acetoxy-27-hydroxy-20(29)-lupen-28-oicacidmethylester | 263844-80-0 | 2A-9067793 |
| 5-bromo-4,6-dichloropyrimidin-2-amine | 7781-26-2 | 2A-9067794 |
| 3-(2-Hydroxyphenyl)-2-propenal | 60125-23-7 | 2A-9067797 |
| 9-Oxo-2,7-bisaboladien-15-oicacid | 93888-59-6 | 2A-9067802 |
| Methylisocostate | 132342-55-3 | 2A-9067804 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS