
CAS Number481-18-5
Synonymsa-Spinasterin; Bessisterol; Spinasterol; (3b,5a,22E)-Stigmasta-7,22-dien-3-ol; Alpha-Spinasterol; spinasta-7,22-dien-3-ol; Hitodesterol; Chondrillasterol; a-Spinasterol; α-Spinasterin; (3β,5α,22E)-Stigmasta-7,22-dien-3-ol
Molecular FormulaC29H48O
Molecular Weight412.69
Purity≥98 (HPLC)%
Density1.0±0.1 g/cm3
Boiling Point500.0±44.0 °C at 760 mmHg
Melting Point168-169°
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 481-18-5 |
| Catalog No. | 2A-9067730 |
| Chinese Name | alpha-菠菜甾醇 |
| Synonyms | a-Spinasterin; Bessisterol; Spinasterol; (3b,5a,22E)-Stigmasta-7,22-dien-3-ol; Alpha-Spinasterol; spinasta-7,22-dien-3-ol; Hitodesterol; Chondrillasterol; a-Spinasterol; α-Spinasterin; (3β,5α,22E)-Stigmasta-7,22-dien-3-ol |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.69 |
| Purity | ≥98 (HPLC) |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 500.0±44.0 °C at 760 mmHg |
| Melting Point | 168-169° |
| Appearance | powder |
| Storage Condition | 2-8℃ |
| Application | α-Spinasterol is isolated from Spinacia oleracea and has antibacterial activity. Alpha-Spinasterol is a transient receptor potential vanilloid 1 (TRPV1) antagonist with anti-inflammatory, antidepressa |
| MDL Number | MFCD00200554 |
| SMILES | C[C@@]12[C@](CC[C@]2([H])[C@H](C)/C=C/[C@@H](CC)C(C)C)([H])C3=CC[C@@]4([H])C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC1 |
| InChI | 1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h8-9,11,19-23,25-27,30H,7,10,12-18H2,1-6H3/b9-8+/t20-,21-,22+,23+,25-,26+,27+,28+,29-/m1/s1 |
| InChI Key | JZVFJDZBLUFKCA-FXIAWGAOSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/67730_1_481_18_5.pdf |
| Transport Info | Product Name: α-Spinosterol |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Astragalinheptaacetate | 2636-51-3 | 2A-9067592 |
| Kaempferol3-neohesperidoside | 32602-81-6 | 2A-9067643 |
| 6-Feruloylcatalpol | 770721-33-0 | 2A-9067645 |
| 2',4'-Dihydroxy-3',6'-dimethoxychalcone | 129724-43-2 | 2A-9067694 |
| 6-O-p-Hydroxybenzoylaucubin | 1016987-87-3 | 2A-9067697 |
| 2-Hydroxy-3-methylanthraquinone | 17241-40-6 | 2A-9067735 |
| Apigenin5-O-beta-D-glucopyranoside | 28757-27-9 | 2A-9067740 |
| Di-O-methylbergenin | 33815-57-5 | 2A-9067774 |
| BlumenolCglucoside | 135820-80-3 | 2A-9067810 |
| TupichilignanA | 69586-96-5 | 2A-9067826 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA