
CAS Number4180-57-8
Synonymsp-(2,3-Dihydroxypropoxy)benzoic acid; BENZOIC ACID,p-(2,3-DIHYDROXYPROPOXY); 3-(p-Carboxyphenoxy)-1,2-propanediol; 4-(2.3-Dihydroxy-propyloxy)-benzoesaeure
Molecular FormulaC10H12O5
Molecular Weight212.19900
Density1.374g/cm3
Boiling Point459.1ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4180-57-8 |
| Catalog No. | 2A-9067572 |
| Chinese Name | 4-(2,3-dihydroxypropoxy)benzoic acid |
| Synonyms | p-(2,3-Dihydroxypropoxy)benzoic acid; BENZOIC ACID,p-(2,3-DIHYDROXYPROPOXY); 3-(p-Carboxyphenoxy)-1,2-propanediol; 4-(2.3-Dihydroxy-propyloxy)-benzoesaeure |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.19900 |
| Density | 1.374g/cm3 |
| Boiling Point | 459.1ºC at 760 mmHg |
| HTC | 2918990090 |
| SMILES | O=C(O)c1ccc(OCC(O)CO)cc1 |
| InChI | InChI=1S/C10H12O5/c11-5-8(12)6-15-9-3-1-7(2-4-9)10(13)14/h1-4,8,11-12H,5-6H2,(H,13,14) |
| InChI Key | KHVXZWBZADAAPR-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| PicrasinB | 26121-56-2 | 2A-9067561 |
| 3alpha-Akebonoicacid | 104777-61-9 | 2A-9067562 |
| 3-Geranyl-4-methoxybenzoicacid | 246266-38-6 | 2A-9067565 |
| Daphmacrine | 19775-48-5 | 2A-9067570 |
| DeoxyisocalyciphyllineB | 619326-75-9 | 2A-9067571 |
| 4-(3-Bromo-2-hydroxypropoxy)benzoic acid | 4257-05-0 | 2A-9067573 |
| Actinidicacid | 341971-45-7 | 2A-9067574 |
| 4-(2,3-Dibromopropoxy)benzoic acid | 4257-04-9 | 2A-9067575 |
| HedyotisolA | 95732-59-5 | 2A-9067576 |
| Oblongine | 60008-01-7 | 2A-9067577 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA