
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3117-38-2 |
| Catalog No. | 2A-9067416 |
| Chinese Name | 2-phenoxy-2-phenylacetic acid |
| Synonyms | ACETIC ACID,PHENOXYPHENYL; Inakt. Phenylaethermandelsaeure; Acide phenoxyphenylacetique; Phenoxy-phenyl-essigsaeure; 2-phenyl-2-phenoxyacetic acid |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 |
| Density | 1.226g/cm3 |
| Boiling Point | 365.8ºC at 760mmHg |
| HTC | 2918990090 |
| MDL Number | MFCD01672636 |
| SMILES | O=C(O)C(Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O3/c15-14(16)13(11-7-3-1-4-8-11)17-12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
| InChI Key | ABUKMOCUMIPDHV-UHFFFAOYSA-N |
| MSDS | msds/67416_1_3117_38_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Evoxine | 522-11-2 | 2A-9067410 |
| 4-Hydroxycinnamamide | 194940-15-3 | 2A-9067411 |
| 1,4,5,6-Tetrahydroxy-7,8-diprenylxanthone | 776325-66-7 | 2A-9067413 |
| N-(4-Acetyl-2,6-dibromophenyl)methanesulfonamide | 199870-60-5 | 2A-9067414 |
| MethyllycernuateA | 56218-46-3 | 2A-9067415 |
| N-(2-Bromo-4-(2-bromoacetyl)phenyl)methanesulfonamide | 199870-61-6 | 2A-9067417 |
| 14,15-Didehydroisoeburnamine | 50838-11-4 | 2A-9067418 |
| Stephavanine | 33116-33-5 | 2A-9067419 |
| 2-Phenyl-2-(phenylamino)acetic acid | 3684-12-6 | 2A-9067420 |
| N-(4-(2,2-Dibromoacetyl)phenyl)methanesulfonamide | 199870-62-7 | 2A-9067421 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA