
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2969-61-1 |
| Catalog No. | 2A-9067308 |
| Chinese Name | 9H-Fluoren-9-one,2,5-difluoro |
| Synonyms | 2,5-difluorofluorenone; 2,5-Difluor-fluorenon; 2,5-difluoro-9h-fluoren-9-one; 9H-Fluoren-9-one,2,5-difluoro; 2,5-difluoro-9-fluorenone |
| Molecular Formula | C13H6F2O |
| Molecular Weight | 216.189 |
| Density | 1.41g/cm3 |
| Boiling Point | 353.7ºC at 760mmHg |
| HTC | 2914700090 |
| MDL Number | MFCD00032889 |
| SMILES | O=C1c2cc(F)ccc2-c2c(F)cccc21 |
| InChI | InChI=1S/C13H6F2O/c14-7-4-5-8-10(6-7)13(16)9-2-1-3-11(15)12(8)9/h1-6H |
| InChI Key | XBKGWIVVBXZUBM-UHFFFAOYSA-N |
| MSDS | msds/67308_1_2969_61_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(5-Fluoro-1H-indol-3-yl)propyl4-methylbenzenesulfonate | 141071-82-1 | 2A-9067301 |
| N-Ethylbenzo[c]isothiazol-3-amine | 703-83-3 | 2A-9067303 |
| Tirotundin | 56377-67-4 | 2A-9067304 |
| N,N-Dimethylbenzo[c]isothiazol-3-amine | 703-81-1 | 2A-9067305 |
| Ervamycine | 27773-39-3 | 2A-9067307 |
| ErythrininC | 63807-85-2 | 2A-9067309 |
| Seneciphyllinine | 90341-45-0 | 2A-9067310 |
| 4,7-Difluoro-2-nitro-9H-fluoren-9-one | 2969-62-2 | 2A-9067311 |
| 6-O-NicotinoylbarbatinC | 1015776-92-7 | 2A-9067312 |
| 1,2-O-Isopropylidene-beta-D-fructopyranose | 66900-93-4 | 2A-9067313 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA