![2-(Chloromethyl)-2,3-dihydrobenzo[b][1,4]dioxine structure, CAS 2164-33-2](/structures/80000/66913_1_2164_33_2.png)
CAS Number2164-33-2
Synonyms2-chloromethyl-1,4-benzodioxan; F2184-0203; 2-chloromethyl-2,3-dihydro-1,4-benzodioxin; 2-Chlormethyl-2,3-dihydro-benzo[1,4]dioxin; MFCD00014666; 2-chloromethyl-2,3-dihydro-benzo[1,4]dioxine; 2-(chloromethyl)-2H,3H-benzo[e]1,4-dioxane; 2-(chloromethyl)-2,3-dihydro-1,4-benzodioxine; 2-Chloromethyl-1,4-benzodioxane; EINECS 218-502-5; 2-chloromethylbenzodioxane(1,4)
Molecular FormulaC9H9ClO2
Molecular Weight184.624
Density1.224g/cm3
Boiling Point96ºC (0.4 torr)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2164-33-2 |
| Catalog No. | 2A-9066913 |
| Chinese Name | 2-氯甲基-1,4-苯并二恶烷 |
| Synonyms | 2-chloromethyl-1,4-benzodioxan; F2184-0203; 2-chloromethyl-2,3-dihydro-1,4-benzodioxin; 2-Chlormethyl-2,3-dihydro-benzo[1,4]dioxin; MFCD00014666; 2-chloromethyl-2,3-dihydro-benzo[1,4]dioxine; 2-(chloromethyl)-2H,3H-benzo[e]1,4-dioxane; 2-(chloromethyl)-2,3-dihydro-1,4-benzodioxine; 2-Chloromethyl-1,4-benzodioxane; EINECS 218-502-5; 2-chloromethylbenzodioxane(1,4) |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.624 |
| Density | 1.224g/cm3 |
| Boiling Point | 96ºC (0.4 torr) |
| Storage Condition | Should be stored in a cool, dry place. Store in cl |
| HTC | 2932999099 |
| MDL Number | MFCD00014666 |
| SMILES | ClCC1COc2ccccc2O1 |
| InChI | InChI=1S/C9H9ClO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,5-6H2 |
| InChI Key | AYPKYQSHFKQVDL-UHFFFAOYSA-N |
| MSDS | msds/66913_1_2164_33_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-(3-Fluoro-2-methylphenylamino)acetohydrazide | 2554-14-5 | 2A-9066889 |
| 2-(3,4-Difluorophenylamino)acetohydrazide | 2351-01-1 | 2A-9066893 |
| 2-(2-Bromo-4-fluorophenylamino)acetohydrazide | 2351-02-2 | 2A-9066896 |
| 2-(2-Chloro-4-fluorophenylamino)acetohydrazide | 2554-12-3 | 2A-9066899 |
| 2-(3-Chloro-4-fluorophenylamino)acetohydrazide | 2370-44-7 | 2A-9066901 |
| 2-(Bromomethyl)-2,3-dihydrobenzo[b][1,4]dioxine | 2164-34-3 | 2A-9066914 |
| 2-(Chloromethyl)-6-methyl-2,3-dihydrobenzo[b][1,4]dioxine | 2164-35-4 | 2A-9066917 |
| 2-(Chloromethyl)-7-methyl-2,3-dihydrobenzo[b][1,4]dioxine | 2164-36-5 | 2A-9066919 |
| 2-(Chloromethyl)-8-methyl-2,3-dihydrobenzo[b][1,4]dioxine | 2164-45-6 | 2A-9066922 |
| 7-Chloro-2-(chloromethyl)-2,3-dihydrobenzo[b][1,4]dioxine | 2164-44-5 | 2A-9066925 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA