
CAS Number569-80-2
Synonyms5,4'-Dihydroxy-3,6,7-trimethoxyflavone; 6-OH-kaempferol-3,6,7-trimethylether; 5-Hydroxy-2-(4-hydroxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one; Penduletin; 5-Hydroxy-2-(4-hydroxyphenyl)-3,6,7-trimethoxy-4H-chromen-4-one; 4',5-dihydroxy-3,6,7-trimethoxy-flavone
Molecular FormulaC18H16O7
Molecular Weight344.32
Purity≥95.0 (HPLC)%
Density1.5±0.1 g/cm3
Boiling Point595.1±50.0 °C at 760 mmHg
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 569-80-2 |
| Catalog No. | 2A-9066670 |
| Chinese Name | Penduletin |
| Synonyms | 5,4'-Dihydroxy-3,6,7-trimethoxyflavone; 6-OH-kaempferol-3,6,7-trimethylether; 5-Hydroxy-2-(4-hydroxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one; Penduletin; 5-Hydroxy-2-(4-hydroxyphenyl)-3,6,7-trimethoxy-4H-chromen-4-one; 4',5-dihydroxy-3,6,7-trimethoxy-flavone |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 |
| Purity | ≥95.0 (HPLC) |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 595.1±50.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | 2-8℃, dry, sealed |
| Application | Penduletin is a flavonoid compound isolated from Brikelia pendula and Vitex negundo. Penduletin has anticancer activity. Penduletin induces cancer cell apoptosis through the production of ROS [1][2]. |
| MDL Number | MFCD20260567 |
| SMILES | [o]1c2c([c](c(c1c3ccc(cc3)O)OC)=O)c(c(c(c2)OC)OC)O |
| InChI | 1S/C18H16O7/c1-22-12-8-11-13(14(20)17(12)23-2)15(21)18(24-3)16(25-11)9-4-6-10(19)7-5-9/h4-8,19-20H,1-3H3 |
| InChI Key | YSXFFLGRZJWNFM-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/66670_1_569_80_2.pdf |
| Transport Info | Product Name: Lutein |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Pseudotaraxasterol | 464-98-2 | 2A-9066528 |
| Taraxasterol | 1059-14-9 | 2A-9066536 |
| Matairesinol | 580-72-3 | 2A-9066555 |
| 4'-Hydroxywogonin | 57096-02-3 | 2A-9066610 |
| Gallocatechin | 970-73-0 | 2A-9066666 |
| Kaempferol3-O-(6'-O-acetyl)glucoside-7-O-rhamnoside | 66465-24-5 | 2A-9066671 |
| Heraclenol3'-O-beta-D-glucopyranoside | 32207-10-6 | 2A-9066686 |
| Ergosterolperoxide3-O-beta-D-glucopyranoside | 140447-22-9 | 2A-9066745 |
| Secoxyloganinmethylester | 74713-15-8 | 2A-9066776 |
| Quinovicacid3-O-(6-deoxy-beta-D-glucopyranoside)28-O-beta-D-glucopyranosylester | 124727-10-2 | 2A-9066825 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA