
CAS Number439-89-4
Synonyms4-(2-hydroxyethyl)-5-vinylnicotinic acid δ-lactone; 4-<2-Hydroxyaethyl>-5-vinyl-3-pyridin-carboxylic acid lacton; 5-VINYLPYRROLIDONE; 4-(2-Hydroxyethyl)-5-vinylnicotinic lactone; 5-Ethenyl-3,4-dihydro-1H-pyrano(3,4-c)pyridin-1-one; Gentianine; 4-(2-Hydroxyethyl)-5-vinylnicotinic Acid d-Lactone; 5-vinylpyrrolidinone; 2-Pyrrolidinone,5-ethenyl; Erythricine; 5-vinyl-pyrrolidin-2-one; UNII-C2PD310UXB; 5-ethenyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-one; 5-Vinyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-one
Molecular FormulaC10H9NO2
Molecular Weight175.19
Density1.2±0.1 g/cm3
Boiling Point386.5±42.0 °C at 760 mmHg
Melting Point84-86ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 439-89-4 |
| Catalog No. | 2A-9066631 |
| Chinese Name | 龙胆碱 |
| Synonyms | 4-(2-hydroxyethyl)-5-vinylnicotinic acid δ-lactone; 4-<2-Hydroxyaethyl>-5-vinyl-3-pyridin-carboxylic acid lacton; 5-VINYLPYRROLIDONE; 4-(2-Hydroxyethyl)-5-vinylnicotinic lactone; 5-Ethenyl-3,4-dihydro-1H-pyrano(3,4-c)pyridin-1-one; Gentianine; 4-(2-Hydroxyethyl)-5-vinylnicotinic Acid d-Lactone; 5-vinylpyrrolidinone; 2-Pyrrolidinone,5-ethenyl; Erythricine; 5-vinyl-pyrrolidin-2-one; UNII-C2PD310UXB; 5-ethenyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-one; 5-Vinyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-one |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 386.5±42.0 °C at 760 mmHg |
| Melting Point | 84-86ºC |
| Appearance | powder |
| Storage Condition | 2-8℃, dry, sealed |
| Application | Gentianine is a potent metabolite of Swertiamarin with anti-diabetic and anti-inflammatory effects. |
| MDL Number | C10H9NO2 |
| SMILES | C=Cc1cncc2c1CCOC2=O |
| InChI | InChI=1S/C10H9NO2/c1-2-7-5-11-6-9-8(7)3-4-13-10(9)12/h2,5-6H,1,3-4H2 |
| InChI Key | DFNZYFAJQPLJFI-UHFFFAOYSA-N |
| MSDS | msds/66631_1_439_89_4.pdf |
| Transport Info | Product Name: Gentianine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Serpentinine | 36519-42-3 | 2A-9066621 |
| 4-Cyclopropylbutan-2-one | 2046-23-3 | 2A-9066622 |
| Brachynosideheptaacetate | 144765-80-0 | 2A-9066624 |
| N-(2-Chloroethyl)aniline hydrochloride | 874-78-2 | 2A-9066628 |
| 2,3,24-Trihydroxy-12-ursen-28-oicacid | 89786-83-4 | 2A-9066629 |
| 4-((2-Chloroethyl)amino)benzoic acid hydrochloride | 1669-80-3 | 2A-9066634 |
| 20(29)-Lupene-3,23-diol | 32451-85-7 | 2A-9066636 |
| 4-((2-Chloroethyl)(ethyl)amino)benzoic acid hydrochloride | 1669-81-4 | 2A-9066637 |
| Esculenticacid | 103974-74-9 | 2A-9066638 |
| S-Ethyl pyrimidin-2-ylcarbamothioate | 2951-00-0 | 2A-9066639 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA