
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 696-82-2 |
| Catalog No. | 2A-9066114 |
| Chinese Name | 2,4,6-三氟嘧啶 |
| Synonyms | 2,4,6-trifluoropyrimidine; MFCD00039705; EINECS 211-801-1 |
| Molecular Formula | C4H1N2F3 |
| Molecular Weight | 134.06 |
| Density | 1.514 g/cm3 |
| Boiling Point | 83 °C |
| Storage Condition | Store in a container filled with dry inert gas and |
| Packaging | II |
| HTC | 2933599090 |
| MDL Number | MFCD00039705 |
| SMILES | Fc1cc(F)nc(F)n1 |
| InChI | InChI=1S/C4HF3N2/c5-2-1-3(6)9-4(7)8-2/h1H |
| InChI Key | NTSYSQNAPGMSIH-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/66114_1_696_82_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 7-Chloro-1H-indole-3-carbaldehyde | 1008-07-7 | 2A-9066066 |
| 1H-Imidazole-5-carboxylicacid,2-methyl-4-(2-methylpropyl)-,methylester | 1150617-77-8 | 2A-9066071 |
| 2-Pyridinecarboxylicacid,6-amino-3-bromo-,methylester | 178876-83-0 | 2A-9066072 |
| Ethyl 2-amino-4-phenylpyrimidine-5-carboxylate | 77995-05-2 | 2A-9066110 |
| 2-Amino-4-phenylpyrimidine-5-carboxylic acid | 91093-42-4 | 2A-9066111 |
| 6-(Hydroxyamino)pyrimidine-2,4(1H,3H)-dione | 4730-34-1 | 2A-9066122 |
| 2-Chloro-4-(methylthio)pyrimidine | 49844-93-1 | 2A-9066125 |
| 4-(Methylthio)pyrimidine-2(1H)-thione | 51674-12-5 | 2A-9066128 |
| 4-(Benzo[b]thiophen-3-ylmethyl)morpholine hydrochloride | 3853-85-8 | 2A-9066139 |
| N3-isopropyl-N6-phenylpyridazine-3,6-diamine | 1023-55-8 | 2A-9066143 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA