
CAS Number39973-76-7
Synonyms3-ethoxy-2-benzoyl-acrylic acid ethyl ester; Einecs 254-723-3; ethyl ethoxymethylenbenzoylacetate; ethyl 2-benzoyl-3-ethoxyacrylate; 2-benzoyl-3-ethoxyacrylic acid ethyl ester
Molecular FormulaC14H16O4
Molecular Weight248.27400
Density1.111g/cm3
Boiling Point373.3ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39973-76-7 |
| Catalog No. | 2A-9066109 |
| Chinese Name | Benzenepropanoic acid, a-(ethoxymethylene)-b-oxo-, ethyl ester |
| Synonyms | 3-ethoxy-2-benzoyl-acrylic acid ethyl ester; Einecs 254-723-3; ethyl ethoxymethylenbenzoylacetate; ethyl 2-benzoyl-3-ethoxyacrylate; 2-benzoyl-3-ethoxyacrylic acid ethyl ester |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.27400 |
| Density | 1.111g/cm3 |
| Boiling Point | 373.3ºC at 760mmHg |
| HTC | 2918990090 |
| SMILES | CCOC=C(C(=O)OCC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16O4/c1-3-17-10-12(14(16)18-4-2)13(15)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3/b12-10- |
| InChI Key | YAHUDNWHZFLCBN-BENRWUELSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,5-Dichloro-4-nitrobenzoic acid | 69708-32-3 | 2A-9066104 |
| 2-Phenyl-2,3-dihydrobenzo[b][1,4]thiazepin-4(5H)-one | 29476-22-0 | 2A-9066105 |
| N-(3-Chloropropyl)-N-cyclohexylcyclohexanamine | 92793-85-6 | 2A-9066106 |
| Ethyl 2-benzoyl-5-oxopentanoate | 92252-32-9 | 2A-9066107 |
| Ethyl 2-benzoyl-5,5-diethoxypentanoate | 98764-77-3 | 2A-9066108 |
| N1,N3-Bis(4-methoxybenzylidene)propane-1,3-diamine | 6958-31-2 | 2A-9066112 |
| N1,N3-Bis(4-chlorobenzylidene)propane-1,3-diamine | 7147-21-9 | 2A-9066113 |
| 5-Methyl-4-thioxo-3,4-dihydropyrimidin-2(1H)-one | 35455-79-9 | 2A-9066115 |
| 6-Methylhept-5-en-2-ol | 1569-60-4 | 2A-9066116 |
| 6-Methylheptan-3-ol | 18720-66-6 | 2A-9066117 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA