CAS Number20869-95-8
Synonyms5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)chromen-4-one; 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4-chromenone; 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)chromone; NCI60_002742; 5,7-Dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4-benzopyrone
Molecular FormulaC17H14O6
Molecular Weight314.29
Density1.5±0.1 g/cm3
Boiling Point552.0±50.0 °C at 760 mmHg
Appearanceyellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 20869-95-8 |
| Catalog No. | 2A-9065954 |
| Chinese Name | 堪非醇3,4'-二-O-甲醚 |
| Synonyms | 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)chromen-4-one; 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4-chromenone; 5,7-dihydroxy-3-methoxy-2-(4-methoxyphenyl)chromone; NCI60_002742; 5,7-Dihydroxy-3-methoxy-2-(4-methoxyphenyl)-4-benzopyrone |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 552.0±50.0 °C at 760 mmHg |
| Appearance | yellow powder |
| Storage Condition | 2-8℃, dry, sealed |
| Application | Ermanin is a flavonoid isolated from Tanacetum microphyllum. Ermanin effectively inhibits iNOS, COX-2 activity, and inhibits platelet aggregation, and has anti-inflammatory, anti-tubercular and anti-v |
| HTC | 2914509090 |
| MDL Number | C17H14O6 |
| SMILES | COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)cc1 |
| InChI Key | RJCJVIFSIXKSAH-UHFFFAOYSA-N |
| MSDS | msds/65954_1_20869_95_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N,N',1-Trimethylhydrazinecarboximidamide hydroiodide | 89603-07-6 | 2A-9065944 |
| 3-Oxo-24,25,26,27-tetranortirucall-7-en-23,21-olide | 828935-47-3 | 2A-9065945 |
| Cassiachromone | 28955-30-8 | 2A-9065946 |
| Sambutoxin | 160047-56-3 | 2A-9065948 |
| Erythrartine | 51666-26-3 | 2A-9065952 |
| 4',5-Dihydroxy-3',5',6,7-tetramethoxyflavone | 83133-17-9 | 2A-9065956 |
| Diacetonamine | 625-04-7 | 2A-9065957 |
| Pinusolide | 31685-80-0 | 2A-9065960 |
| Koaburaside | 41653-73-0 | 2A-9065962 |
| LycernuicacidA | 53755-77-4 | 2A-9065963 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS