
CAS Number59854-11-4
Synonyms2-Methyl-2-propanyl 3-hydroxypropanoate; t-butyl 3-hydroxypropanoate; Propanoic acid, 3-hydroxy-, 1,1-dimethylethyl ester; tert-Butyl 3-hydroxypropionate; 3-hydroxy-propionic acid tert-butyl ester
Molecular FormulaHOCH2CH2COOC(CH3)3
Molecular Weight146.18
Purity≥98.0 (GC)%
Density1.0±0.1 g/cm3
Boiling Point215.7±13.0 °C at 760 mmHg
Appearanceliquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 59854-11-4 |
| Catalog No. | 2A-9065701 |
| Chinese Name | 3-羟基丙酸叔丁酯 |
| Synonyms | 2-Methyl-2-propanyl 3-hydroxypropanoate; t-butyl 3-hydroxypropanoate; Propanoic acid, 3-hydroxy-, 1,1-dimethylethyl ester; tert-Butyl 3-hydroxypropionate; 3-hydroxy-propionic acid tert-butyl ester |
| Molecular Formula | HOCH2CH2COOC(CH3)3 |
| Molecular Weight | 146.18 |
| Purity | ≥98.0 (GC) |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 215.7±13.0 °C at 760 mmHg |
| Appearance | liquid |
| Storage Condition | room temperature |
| HTC | 2918199090 |
| PubChem ID | 57653376 |
| MDL Number | MFCD04974574 |
| SMILES | CC(C)(C)OC(=O)CCO |
| InChI | 1S/C7H14O3/c1-7(2,3)10-6(9)4-5-8/h8H,4-5H2,1-3H3 |
| InChI Key | NSXCURRVJMPAPA-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1854888 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/65701_1_59854_11_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(4-Phenyl-1H-pyrazol-3-yl)formamide | 62538-14-1 | 2A-9065693 |
| 2-Hydroxy-1-phenylpropan-1-one | 90-63-1 | 2A-9065694 |
| 6-Hydroxy-3,5,5-trimethyl-2-cyclohexen-1-one | 61592-66-3 | 2A-9065695 |
| 2-Chlorophenazine | 1137-69-5 | 2A-9065696 |
| 2-Methylene-1-oxo-1,2,3,4-tetrahydronaphthalene | 13203-73-1 | 2A-9065697 |
| 1-Phenoxypentan-2-ol | 87034-17-1 | 2A-9065702 |
| 4-(2-Bromoethoxy)-1,2-dimethylbenzene | 3351-53-9 | 2A-9065703 |
| 4',5,7-Trihydroxy-6-prenylflavone | 68097-13-2 | 2A-9065704 |
| 16-Kaurene-2,6,15-triol | 53452-32-7 | 2A-9065705 |
| 5-Phenylpentan-1-ol | 10521-91-2 | 2A-9065708 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA