
CAS Number7493-58-5
Synonyms4-Methyl-pentan-2,3-dion; 4-methyl-pentane-2,3-dione; Isopropyl methyl diketone; 4-methylpentan-2,3-dione; Acetyl isobutyryl; 2,3-Pentanedione,4-methyl; Methyl-isopropyl-glyoxal; Methyl isopropyl diketone; 4-METHYL-2,3-PENTANEDIONE
Molecular FormulaC6H10O2
Molecular Weight114.14200
Density0.934 g/cm3
Boiling Point117.9ºC at 760 mmHg
Melting Point-2.4ºC
AppearanceLight yellow to yellow transparent liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7493-58-5 |
| Catalog No. | 2A-9065691 |
| Chinese Name | 2,3-Pentanedione,4-methyl |
| Synonyms | 4-Methyl-pentan-2,3-dion; 4-methyl-pentane-2,3-dione; Isopropyl methyl diketone; 4-methylpentan-2,3-dione; Acetyl isobutyryl; 2,3-Pentanedione,4-methyl; Methyl-isopropyl-glyoxal; Methyl isopropyl diketone; 4-METHYL-2,3-PENTANEDIONE |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14200 |
| Density | 0.934 g/cm3 |
| Boiling Point | 117.9ºC at 760 mmHg |
| Melting Point | -2.4ºC |
| Appearance | Light yellow to yellow transparent liquid |
| SMILES | CC(=O)C(=O)C(C)C |
| InChI | InChI=1S/C6H10O2/c1-4(2)6(8)5(3)7/h4H,1-3H3 |
| InChI Key | JENYBWHRLYZSSZ-UHFFFAOYSA-N |
| MSDS | msds/65691_1_7493_58_5.pdf |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl 2,3-pentadienoate | 74268-51-2 | 2A-9065684 |
| 2-(4-Fluorophenyl)-3-oxopropanenitrile | 398-42-5 | 2A-9065685 |
| 6-Bromoquinazolin-4-amine | 21419-48-7 | 2A-9065688 |
| 2-(4-Methoxyphenyl)-3-oxopropanenitrile | 35070-82-7 | 2A-9065689 |
| 2-Heptyl-2-cyclohexenone | 87588-68-9 | 2A-9065690 |
| N-(4-Phenyl-1H-pyrazol-3-yl)formamide | 62538-14-1 | 2A-9065693 |
| 2-Hydroxy-1-phenylpropan-1-one | 90-63-1 | 2A-9065694 |
| 6-Hydroxy-3,5,5-trimethyl-2-cyclohexen-1-one | 61592-66-3 | 2A-9065695 |
| 2-Chlorophenazine | 1137-69-5 | 2A-9065696 |
| 2-Methylene-1-oxo-1,2,3,4-tetrahydronaphthalene | 13203-73-1 | 2A-9065697 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA