
CAS Number1699-03-2
Synonyms2-(phenylthiomethyl)-benzoic acid; EINECS 216-922-3; MFCD00089444; 2-(Phenylmercapto-methyl)-benzoesaeure; 2-PhenylthioMethylbenzoic Acid; 2-Phenylmercaptomethylbenzoic Acid; 2-(thiophenylmethyl)benzoic acid; 2-(phenylsulfanyl-methyl)-benzoic acid; o-Phenylthiomethylbenzoic acid
Molecular FormulaHOC6H4N=NC6H4CO2H
Molecular Weight242.23
Purity≥90 (HPLC)%
Density1.27g/cm3
Boiling Point417ºC at 760mmHg
Melting Point204-208 °C (lit.)
Appearanceoff-white powder
EINECS216-655-2
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1699-03-2 |
| Catalog No. | 2A-9065574 |
| Chinese Name | 2-苯基硫甲基苯甲酸 |
| Synonyms | 2-(phenylthiomethyl)-benzoic acid; EINECS 216-922-3; MFCD00089444; 2-(Phenylmercapto-methyl)-benzoesaeure; 2-PhenylthioMethylbenzoic Acid; 2-Phenylmercaptomethylbenzoic Acid; 2-(thiophenylmethyl)benzoic acid; 2-(phenylsulfanyl-methyl)-benzoic acid; o-Phenylthiomethylbenzoic acid |
| Molecular Formula | HOC6H4N=NC6H4CO2H |
| Molecular Weight | 242.23 |
| Purity | ≥90 (HPLC) |
| Density | 1.27g/cm3 |
| Boiling Point | 417ºC at 760mmHg |
| Melting Point | 204-208 °C (lit.) |
| Appearance | off-white powder |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| EINECS | 216-655-2 |
| HTC | 2930909090 |
| PubChem ID | 57654257 |
| MDL Number | MFCD00002428 |
| SMILES | Oc1ccc(cc1)\N=N\c2ccccc2C(O)=O |
| InChI | 1S/C13H10N2O3/c16-10-7-5-9(6-8-10)14-15-12-4-2-1-3-11(12)13(17)18/h1-8,16H,(H,17,18)/b15-14+ |
| InChI Key | DWQOTEPNRWVUDA-CCEZHUSRSA-N |
| Beilstein/REAXYS | 1842696 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/65574_1_1699_03_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6,11-Dihydro-5H-dibenzo[b,e]azepine | 449-55-8 | 2A-9065569 |
| 11-Hydroxy-5H-dibenzo[b,e]azepin-6(11H)-one | 723-87-5 | 2A-9065570 |
| 2-((4-Chlorophenoxy)methyl)benzonitrile | 92161-45-0 | 2A-9065571 |
| 2-(Phenylthiomethyl)benzonitrile | 92164-25-5 | 2A-9065572 |
| 2-((4-Chlorophenoxy)methyl)benzoic acid | 23560-70-5 | 2A-9065573 |
| Dibenzo[b,e]thiepin-11(6H)-one-5,5-dioxide | 33301-21-2 | 2A-9065575 |
| 6,11-Dihydrodibenzo[b,e]oxepin-11-ol | 5251-26-3 | 2A-9065576 |
| 2-(4-Hydroxy-2,6,7-trimethylquinolin-3-yl)acetic acid | 92248-67-4 | 2A-9065577 |
| 2-(4-Hydroxy-6,7-dimethylcinnolin-3-yl)acetic acid | 69352-78-9 | 2A-9065578 |
| 4-Methyl-3-phenyl-2-(pyridin-3-yl)pentanenitrile | 94822-03-4 | 2A-9065579 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA