
CAS Number105151-39-1
Synonyms2,3-Pyridinedicarboxylicacid,5-ethyl-,2,3-diethyl ester; diethyl ester of 5-ethylpyridine-2,3-dicarboxylic acid; 5-ethyl-2,3-pyridinedicarboxylic acid diethyl ester; diethyl 5-ethyl-2,3-pyridinedicarboxylate; 5-Ethylpyridine-2,3-dicarboxylic acid diethyl ester; MFCD06658212; 5-ethyl-2,3-diethoxycarbonylpyridine; 5-ethylpyridine dicarboxylic acid,diethyl ester
Molecular FormulaC13H17O4N1
Molecular Weight251.28
Purity98%
Density1.12g/cm3
Boiling Point351.6ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 105151-39-1 |
| Catalog No. | 2A-9006511 |
| Chinese Name | 5-乙基吡啶-2,3-二羧酸二乙酯 |
| Synonyms | 2,3-Pyridinedicarboxylicacid,5-ethyl-,2,3-diethyl ester; diethyl ester of 5-ethylpyridine-2,3-dicarboxylic acid; 5-ethyl-2,3-pyridinedicarboxylic acid diethyl ester; diethyl 5-ethyl-2,3-pyridinedicarboxylate; 5-Ethylpyridine-2,3-dicarboxylic acid diethyl ester; MFCD06658212; 5-ethyl-2,3-diethoxycarbonylpyridine; 5-ethylpyridine dicarboxylic acid,diethyl ester |
| Molecular Formula | C13H17O4N1 |
| Molecular Weight | 251.28 |
| Purity | 98 |
| Density | 1.12g/cm3 |
| Boiling Point | 351.6ºC at 760mmHg |
| Storage Condition | 2-8°C, dry, sealed |
| HTC | 2933399090 |
| MDL Number | MFCD06658212 |
| SMILES | CCOC(=O)c1cc(CC)cnc1C(=O)OCC |
| InChI Key | VSPXTWXXNZJEHM-UHFFFAOYSA-N |
| MSDS | msds/6511_1_105151_39_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-Difluoromethoxy-2-[(3,4-dimethoxy-2-pyridinyl)methyl]thio-1H-benzimidazole | 102625-64-9 | 2A-9006502 |
| 5-Difluoromethoxy-2-[(4-chloro-3-methoxy-2-pyridinyl)methyl]thio-1H-benzimidazole | 368890-20-4 | 2A-9006503 |
| 5-Difluoromethoxy-2-mercapto-1H-benzimidazole | 97963-62-7 | 2A-9006504 |
| 5-Ethoxy-4-methyloxazole | 5006-20-2 | 2A-9006506 |
| 5-Ethyl-2-pyridine alcohol | 53428-03-8 | 2A-9006509 |
| 5-Ethylthio-1H-tetrazole | 89797-68-2 | 2A-9006512 |
| 5-Ethylthiotetrazole | 133122-98-2 | 2A-9006513 |
| 5-Fluoro-2-methoxypyridine | 51173-04-7 | 2A-9006525 |
| 5-Fluoro-2-methylindole | 399-72-4 | 2A-9006529 |
| 5-Fluoro-3-methylindole | 392-13-2 | 2A-9006538 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA