
CAS Number18910-19-5
Synonyms3-(4-acetylphenyl)-2-bromopropanoic acid; 3-(4-acetylphenyl)-2-bromo-propanoic acid; 3-(4-acetylphenyl)-2-bromo-propionic acid; 2-bromo-3-(4-ethanoylphenyl)propanoic acid; NSC101130
Molecular FormulaC11H11BrO3
Molecular Weight271.10700
Density1.519g/cm3
Boiling Point389.5ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18910-19-5 |
| Catalog No. | 2A-9065066 |
| Chinese Name | 3-(4-乙酰基苯基)-2-溴丙酸 |
| Synonyms | 3-(4-acetylphenyl)-2-bromopropanoic acid; 3-(4-acetylphenyl)-2-bromo-propanoic acid; 3-(4-acetylphenyl)-2-bromo-propionic acid; 2-bromo-3-(4-ethanoylphenyl)propanoic acid; NSC101130 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.10700 |
| Density | 1.519g/cm3 |
| Boiling Point | 389.5ºC at 760mmHg |
| HTC | 2918300090 |
| SMILES | CC(=O)c1ccc(CC(Br)C(=O)O)cc1 |
| InChI | InChI=1S/C11H11BrO3/c1-7(13)9-4-2-8(3-5-9)6-10(12)11(14)15/h2-5,10H,6H2,1H3,(H,14,15) |
| InChI Key | OTXNYZKECLXPSN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,2,4-Trimethyl-3-oxovaleryl chloride | 10472-34-1 | 2A-9065056 |
| 2,4,6-Trimethylpyrylium tetrafluoroborate | 773-01-3 | 2A-9065057 |
| 2,4,6-Trimethylpyrylium trifluoromethanesulfonate | 40927-60-4 | 2A-9065058 |
| N,a-Diphenylnitrone | 1137-96-8 | 2A-9065059 |
| S-Acetamidomethyl-L-cysteine hydrochloride | 28798-28-9 | 2A-9065065 |
| 2-Acetyl-2-cyclohexen-1-one | 52784-38-0 | 2A-9065067 |
| Dimethyl-2-propynylsulfonium bromide | 23451-62-9 | 2A-9065068 |
| 3-n-Butyl-2,4-pentanedione | 1540-36-9 | 2A-9065072 |
| Diethyl 2,2-diethoxyethylphosphonate | 7598-61-0 | 2A-9065075 |
| Diethyl formylmethylphosphonate | 1606-75-3 | 2A-9065076 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA