
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3723-23-7 |
| Catalog No. | 2A-9065035 |
| Chinese Name | Desylamine |
| Synonyms | 2-amino-1,2-diphenyl-ethanone; Desylamine |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.25900 |
| Density | 1.135g/cm3 |
| Boiling Point | 363.6ºC at 760 mmHg |
| HTC | 2922399090 |
| SMILES | NC(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H13NO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13H,15H2 |
| InChI Key | LKPGGRAYFGWREN-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N,N-Diethyl-4-(hydrazinylmethyl)aniline | 91334-33-7 | 2A-9065026 |
| p-Phenylphenacylamine | 51127-68-5 | 2A-9065027 |
| a-Aminovalerophenone | 31952-46-2 | 2A-9065030 |
| 2-Amino-1-tetralone | 60505-03-5 | 2A-9065032 |
| 2-Amino-4,4-dimethyl-1-tetralone | 790595-18-5 | 2A-9065034 |
| Phenyl t-butyl ether | 6669-13-2 | 2A-9065036 |
| Phenanthrene, 9-phenyl- | 844-20-2 | 2A-9065039 |
| 3-Phenylsydnone | 120-06-9 | 2A-9065040 |
| 1-Phenyl-2-thiobiuret | 53555-72-9 | 2A-9065042 |
| Styrylphosphonic dichloride | 4708-07-0 | 2A-9065043 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA