![(4'-Propyl[1,1'-biphenyl]-4-yl)boronic acid structure, CAS 153035-56-4](/structures/80000/65024_1_153035_56_4.png)
CAS Number153035-56-4
Synonyms(4'-Propyl-4-biphenylyl)boronic acid; 4'-n-propyl-4-biphenylboronic acid; (4'-Propyl[1,1'-biphenyl]-4-yl)-boronic acid
Molecular FormulaC15H17BO2
Molecular Weight240.105
Density1.1±0.1 g/cm3
Boiling Point413.1±48.0 °C at 760 mmHg
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 153035-56-4 |
| Catalog No. | 2A-9065024 |
| Chinese Name | 4'-丙基-4-联苯硼酸 |
| Synonyms | (4'-Propyl-4-biphenylyl)boronic acid; 4'-n-propyl-4-biphenylboronic acid; (4'-Propyl[1,1'-biphenyl]-4-yl)-boronic acid |
| Molecular Formula | C15H17BO2 |
| Molecular Weight | 240.105 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 413.1±48.0 °C at 760 mmHg |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | room temperature |
| SMILES | CCCc1ccc(-c2ccc(B(O)O)cc2)cc1 |
| InChI Key | NOQFUISBLHCDSR-UHFFFAOYSA-N |
| MSDS | msds/65024_1_153035_56_4.pdf |
| Transport Info | Product name: 4'-propyl-4-biphenylboronic acid (containing different amounts of anhydride) |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Isopropyl-1-methyl-9H-xanthene-9-carboxylic acid | 101790-13-0 | 2A-9064997 |
| 4,5-Dimethyl-9H-xanthene-9-carboxylic acid | 108896-86-2 | 2A-9065000 |
| 2,3,4,4a,9,9a-Hexahydro-1H-xanthene-9-carboxylic acid | 860178-88-7 | 2A-9065003 |
| 4-(Trans-4-pentylcyclohexyl)phenyl]boronic acid | 143651-26-7 | 2A-9065016 |
| (4'-Ethyl[1,1'-biphenyl]-4-yl)boronic acid | 153035-62-2 | 2A-9065019 |
| (4'-Butyl[1,1'-biphenyl]-4-yl)boronic acid | 145413-17-8 | 2A-9065041 |
| (4'-Pentyl[1,1'-biphenyl]-4-yl)boronic acid | 121554-18-5 | 2A-9065044 |
| 1-Formyl-3-thiosemicarbazide | 2302-84-3 | 2A-9065054 |
| Ethyl 1-cyano-2-methylcyclohexanecarboxylate | 5231-79-8 | 2A-9065090 |
| 4-(Trans-4-ethylcyclohexyl)-4'-(trifluoromethyl)-1,1'-biphenyl | 1072141-52-6 | 2A-9065130 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA