CAS Number3480-87-3
Synonyms3-hydroxy-3-phenylpropionic acid; 3-Hydroxy-3-phenylpropanoic acid; 3-Hydroxy-3-phenyl-propionic acid; 3-(2-Hydroxyphenyl)propanoic acid; 3-hydroxyphenylpropionic acid; Propanoic acid,3-hydroxy-3-phenyl; 3-hydroxy,3'-phenyl propanoic acid; 3-(2-Hydroxyphenyl)propionate; DL-3-phenyllactic acid
Molecular FormulaC9H10O3
Molecular Weight166.174
Density1.3±0.1 g/cm3
Boiling Point329.4±30.0 °C at 760 mmHg
Melting Point92.0 to 96.0 deg-C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3480-87-3 |
| Catalog No. | 2A-9064914 |
| Chinese Name | 3-羟基-3-苯基丙酸 |
| Synonyms | 3-hydroxy-3-phenylpropionic acid; 3-Hydroxy-3-phenylpropanoic acid; 3-Hydroxy-3-phenyl-propionic acid; 3-(2-Hydroxyphenyl)propanoic acid; 3-hydroxyphenylpropionic acid; Propanoic acid,3-hydroxy-3-phenyl; 3-hydroxy,3'-phenyl propanoic acid; 3-(2-Hydroxyphenyl)propionate; DL-3-phenyllactic acid |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.174 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 329.4±30.0 °C at 760 mmHg |
| Melting Point | 92.0 to 96.0 deg-C |
| Storage Condition | Room temperature, sealed, dry |
| HTC | 2918199090 |
| SMILES | O=C(O)CC(O)c1ccccc1 |
| InChI | InChI=1S/C9H10O3/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12) |
| InChI Key | AYOLELPCNDVZKZ-UHFFFAOYSA-N |
| MSDS | msds/64914_1_3480_87_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3-Hydroxy-3-phenylpropionic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cbz-S-3-Amino-3-phenylpropan-1-ol | 869468-32-6 | 2A-9064905 |
| Cbz-R-3-Amino-3-phenylpropan-1-ol | 888298-05-3 | 2A-9064907 |
| tert-Butyl 5-oxo-D-prolinate | 205524-46-5 | 2A-9064908 |
| R-2-Bromo-3-methylbutyric acid | 76792-22-8 | 2A-9064911 |
| (-)-10,2-Camphorsultam | 94594-90-8 | 2A-9064912 |
| L-4-Methoxymandelic acid | 10502-44-0 | 2A-9064915 |
| Isoindolin-1-one | 480-91-1 | 2A-9064920 |
| 2-Fluoroisobutanoic acid | 63812-15-7 | 2A-9064934 |
| Ethyl 4-acetylbenzoate | 116-69-8 | 2A-9064935 |
| tert-Butyl 1-benzhydryl-3-azetidinylcarbamate | 91189-18-3 | 2A-9064938 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS