
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 92736-81-7 |
| Catalog No. | 2A-9064874 |
| Chinese Name | 2',4'-二氯-2,2,2-三氟苯乙酮 |
| Synonyms | 1-(2,4-Dichlorophenyl)-2,2,2-trifluoroethanone |
| Molecular Formula | C8H3O1Cl2F3 |
| Molecular Weight | 243.01 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 229.6±35.0 °C at 760 mmHg |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2914700090 |
| MDL Number | MFCD02260843 |
| SMILES | O=C(c1ccc(Cl)cc1Cl)C(F)(F)F |
| InChI Key | MKBRURHQKRNOCM-UHFFFAOYSA-N |
| MSDS | msds/64874_1_92736_81_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Amino-2-methyl-10H-thiene[2,3-b][1,5]benzodiazepine hydrochloride | 138564-60-0 | 2A-9064865 |
| Benzyltrimethylammonium bromide | 114971-52-7 | 2A-9064866 |
| Butanedioic acid, sulfo-, laureth-12 ester, disodium salt | 39354-45-5 | 2A-9064871 |
| Benzoicacid, 2-(aminocarbonyl)-, N,N-bis(hydrogenated tallow alkyl) derivs | 127733-92-0 | 2A-9064872 |
| N,N-Dimethyldodecylamine-N-oxide | 1643-20-5 | 2A-9064873 |
| 2-([(Benzyloxy)carbonyl]amino)-2-hydroxyacetic acid | 56538-57-9 | 2A-9064888 |
| Cbz-1-Amino-1-cyclopropanecarbonitrile | 1159735-22-4 | 2A-9064891 |
| DL-3-Amino-3-(4-methoxy-phenyl)propionic acid | 4678-45-5 | 2A-9064902 |
| 3-(Formylamino)-3-phenylpropanoic acid | 126575-05-1 | 2A-9064903 |
| Ethyl 3-amino-3-phenylpropanoate | 6335-76-8 | 2A-9064904 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA