
CAS Number54127-63-8
Synonyms5-Chloro-6-oxo-1,6-dihydro-3-pyridinecarboxylic acid; 5-chloro-6-hydroxypyridine-3-carboxylic acid; 5-Chloro-6-hydroxy-3-pyridinecarboxylic Acid; 5-Chloro-6-hydroxynicotinic acid; 5-chloro-6-oxo-1H-pyridine-3-carboxylic acid; MFCD00052950
Molecular FormulaC6H4ClNO3
Molecular Weight173.554
Purity98%
Density1.6±0.1 g/cm3
Boiling Point437.3±45.0 °C at 760 mmHg
Melting Point≥300 °C(lit.)
Appearancebeige powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54127-63-8 |
| Catalog No. | 2A-9006465 |
| Chinese Name | 5-氯-6-羟基烟酸 |
| Synonyms | 5-Chloro-6-oxo-1,6-dihydro-3-pyridinecarboxylic acid; 5-chloro-6-hydroxypyridine-3-carboxylic acid; 5-Chloro-6-hydroxy-3-pyridinecarboxylic Acid; 5-Chloro-6-hydroxynicotinic acid; 5-chloro-6-oxo-1H-pyridine-3-carboxylic acid; MFCD00052950 |
| Molecular Formula | C6H4ClNO3 |
| Molecular Weight | 173.554 |
| Purity | 98 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 437.3±45.0 °C at 760 mmHg |
| Melting Point | ≥300 °C(lit.) |
| Appearance | beige powder |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2933399090 |
| SMILES | O=C(O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C6H4ClNO3/c7-4-1-3(6(10)11)2-8-5(4)9/h1-2H,(H,8,9)(H,10,11)/p-1 |
| InChI Key | OLTRUTPHSBQWAZ-UHFFFAOYSA-N |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S37/39 |
| MSDS | msds/6465_1_54127_63_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 5-Chloro-6-hydroxynicotinic acid Modification number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Chloro-2-nitrobenzoic acid | 2516-95-2 | 2A-9006453 |
| 5-Chloro-2-nitrobenzotrifluoride | 118-83-2 | 2A-9006454 |
| 5-Chloro-2-nitrodiphenylamine | 25781-92-4 | 2A-9006455 |
| 5-Chloro-3-hydroxy-1-(piperidin-4-yl)-1H-benzo[d]imidazol-2(3H)-one | 2A-106458 | 2A-9006458 |
| 5-Chloro-4-fluoro-2-nitroaniline | 104222-34-6 | 2A-9006462 |
| 5-Chloro-7-methylisatin | 14389-06-1 | 2A-9006466 |
| 5-Chloroacetamido-6-methyluracil | 27870-38-8 | 2A-9006467 |
| 5-Chlorobenzothiazolone | 20600-44-6 | 2A-9006469 |
| 5-Chloroethyl-6-chloro-1,3-dihydro-1H-indol-2-one | 118289-55-7 | 2A-9006473 |
| 5-Chloronicotinic acid | 22620-27-5 | 2A-9006482 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA