
CAS Number1821-27-8
Synonyms4-nitro-4'-nitrodiphenylamine; Bis(4-nitrophenyl)aMine; 4,4'-Dinitrodiphenylamine; Bis-(4-nitrophenyl)amine
Molecular FormulaC12H9N3O4
Molecular Weight327.01
Purity97%
Density1.446 g/cm3
Boiling Point464.1ºC at 760 mmHg
Melting Point105-108 °C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1821-27-8 |
| Catalog No. | 2A-9064572 |
| Chinese Name | 双(4-硝基苯基)胺 |
| Synonyms | 4-nitro-4'-nitrodiphenylamine; Bis(4-nitrophenyl)aMine; 4,4'-Dinitrodiphenylamine; Bis-(4-nitrophenyl)amine |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 327.01 |
| Purity | 97 |
| Density | 1.446 g/cm3 |
| Boiling Point | 464.1ºC at 760 mmHg |
| Melting Point | 105-108 °C |
| Appearance | solid |
| Storage Condition | Keep the receptacle sealed and stored in a cool, d |
| HTC | 2921499090 |
| PubChem ID | 329760099 |
| MDL Number | MFCD00225488 |
| SMILES | Brc1ccc(Nc2ccc(Br)cc2)cc1 |
| InChI | 1S/C12H9Br2N/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8,15H |
| InChI Key | VKVHTZNHLOGHGP-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/64572_1_1821_27_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Isopropyl-4-piperidinol | 5570-78-5 | 2A-9064565 |
| N-(2-(Phenylamino)phenyl)benzenesulfonamide | 101731-54-8 | 2A-9064566 |
| N-(4-(N-(2-(Phenylamino)phenyl)sulfamoyl)phenyl)acetamide | 102238-51-7 | 2A-9064568 |
| 4-Amino-N-(2-(phenylamino)phenyl)benzenesulfonamide | 101721-25-9 | 2A-9064570 |
| 1-(3-Bromopropyl)-4-chlorobenzene | 64473-35-4 | 2A-9064571 |
| 3-Butenoic acid, 2-methylpropyl ester | 24342-03-8 | 2A-9064574 |
| Nitrous acid, cyclohexyl ester | 5156-40-1 | 2A-9064575 |
| Benzene, 1-methyl-4-nitroso- | 623-11-0 | 2A-9064576 |
| 3-Chloro-4-(6-chloro-5-fluoropyrimidin-4-ylamino)benzonitrile | 1147558-27-7 | 2A-9064579 |
| 4-(3-Fluorophenyl)-7-methyl-2H-chromen-2-one | 1044277-06-6 | 2A-9064580 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA