
CAS Number19219-99-9
Synonyms5-chloro-2-methyl-benzooxazole; 5-Chloro-2-methylbenzoxazole; 5-Chloro-2-methyl-1,3-benzoxazole; EINECS 242-888-4; BENZOXAZOLE,5-CHLORO-2-METHYL; 5-Chloro-2-methylbenzo[d]oxazole; 2-Methyl-5-chlorobenzoxazole; 5-Chlor-2-methyl-benzoxazol; MFCD00022850
Molecular FormulaC8H6O1N1Cl1
Molecular Weight167.59
Purity98%
Density1.3±0.1 g/cm3
Boiling Point241.6±13.0 °C at 760 mmHg
Melting Point55-57 °C(lit.)
AppearanceColorless oily liquid to white crystals
EINECS242-888-4
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 19219-99-9 |
| Catalog No. | 2A-9006448 |
| Chinese Name | 2-甲基-5-氯苯并恶唑 |
| Synonyms | 5-chloro-2-methyl-benzooxazole; 5-Chloro-2-methylbenzoxazole; 5-Chloro-2-methyl-1,3-benzoxazole; EINECS 242-888-4; BENZOXAZOLE,5-CHLORO-2-METHYL; 5-Chloro-2-methylbenzo[d]oxazole; 2-Methyl-5-chlorobenzoxazole; 5-Chlor-2-methyl-benzoxazol; MFCD00022850 |
| Molecular Formula | C8H6O1N1Cl1 |
| Molecular Weight | 167.59 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 241.6±13.0 °C at 760 mmHg |
| Melting Point | 55-57 °C(lit.) |
| Appearance | Colorless oily liquid to white crystals |
| Storage Condition | Room temperature, sealed, dry |
| Packaging | III |
| EINECS | 242-888-4 |
| HTC | 29349990 |
| UN(IATA) | UN 1759 |
| MDL Number | MFCD00022850 |
| SMILES | Cc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C8H6ClNO/c1-5-10-7-4-6(9)2-3-8(7)11-5/h2-4H,1H3 |
| InChI Key | HJCIGAUHTJBHBQ-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S36/39 |
| MSDS | msds/6448_1_19219_99_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 5-Chloro-2-methylbenzoxazole Modification number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-Chloro-2,4,6-trifluoropyrimidine | 697-83-6 | 2A-9006413 |
| 5-Chloro-2-cyano-3-nitropyridine | 181123-11-5 | 2A-9006421 |
| 5-Chloro-2-cyanopyridine | 89809-64-3 | 2A-9006422 |
| 5-Chloro-2-fluoropyridine | 1480-65-5 | 2A-9006436 |
| 5-Chloro-2-hydroxy-3-nitropyridine | 21427-61-2 | 2A-9006440 |
| 5-Chloro-2-methylene-1,3,3-trimethylindoline | 6872-17-9 | 2A-9006449 |
| 5-Chloro-2-nitropyridine | 52092-47-4 | 2A-9006456 |
| 5-Chloro-3-(methoxycarbonylmethylmethylsulfamoyl)thiophene-2-carboxylic acid methyl ester | 2A-106457 | 2A-9006457 |
| 5-Chloro-3-methylbenzo[b]thiophene-2-sulphonyl chloride | 166964-33-6 | 2A-9006459 |
| 5-Chloro-3-phenylbenzo[c]isoxazole | 719-64-2 | 2A-9006460 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA