
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 333355-35-4 |
| Catalog No. | 2A-9064469 |
| Chinese Name | Ethyl 6-(3-chlorophenyl)-6-oxohexanoate |
| Synonyms | 5-chlorobenzoyl valeric acid,ethyl ester |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 268.73600 |
| Density | 1.141g/cm3 |
| Boiling Point | 377.4ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2918300090 |
| MDL Number | MFCD03068907 |
| SMILES | CCOC(C(C=CC(C1=CC=C(Cl)C=C1)=N2)=C2C)=O |
| InChI | 1S/C15H14ClNO2/c1-3-19-15(18)13-8-9-14(17-10(13)2)11-4-6-12(16)7-5-11/h4-9H,3H2,1-2H3 |
| InChI Key | DLVNZWGMQHOLOW-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352101 |
| MSDS | msds/64469_1_333355_35_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl 8-(4-methoxyphenyl)-6-oxooctanoate | 333355-26-3 | 2A-9064464 |
| Ethyl 6-cyclohexyl-6-oxohexanoate | 16076-62-3 | 2A-9064465 |
| 1-Ethyl 11-methyl 6-oxoundecanedioate | 333355-37-6 | 2A-9064466 |
| Ethyl 6,9-dioxo-9-phenylnonanoate | 333355-40-1 | 2A-9064467 |
| Ethyl 6-oxo-6-phenylhexanoate | 4248-25-3 | 2A-9064468 |
| Ethyl 6-oxo-6-(thiophen-3-yl)hexanoate | 333355-34-3 | 2A-9064471 |
| 2-Benzyloxy-1-methylpyridinium trifluoromethanesulfonate | 882980-43-0 | 2A-9064473 |
| (3-(Benzyloxy)propyl)benzene | 70770-06-8 | 2A-9064474 |
| 1-(4-(Benzyloxy)butyl)-4-methoxybenzene | 888709-54-4 | 2A-9064475 |
| ((2-(2-Methoxyethoxy)ethoxy)methyl)benzene | 66226-69-5 | 2A-9064476 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA