
CAS Number261723-26-6
Synonyms(5-Chloro-2-fluorophenyl)methanamine; (5-Chloro-2-fluorophenyl)methylamine; 1-(5-Chloro-2-fluorophenyl)methanamine; Z1R CG FF; MFCD01631440; 5-Chloro-2-fluorobenzylamine; 1-(5-Chloro-2-fluorophenyl)methylamine; 2-fluoro-5-chlorobenzyl amine
Molecular FormulaC7H7ClFN
Molecular Weight159.589
Purity97%
Density1.3±0.1 g/cm3
Boiling Point216.0±25.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 261723-26-6 |
| Catalog No. | 2A-9006433 |
| Chinese Name | 5-氯-2-氟苄胺 |
| Synonyms | (5-Chloro-2-fluorophenyl)methanamine; (5-Chloro-2-fluorophenyl)methylamine; 1-(5-Chloro-2-fluorophenyl)methanamine; Z1R CG FF; MFCD01631440; 5-Chloro-2-fluorobenzylamine; 1-(5-Chloro-2-fluorophenyl)methylamine; 2-fluoro-5-chlorobenzyl amine |
| Molecular Formula | C7H7ClFN |
| Molecular Weight | 159.589 |
| Purity | 97 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 216.0±25.0 °C at 760 mmHg |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| Packaging | III |
| HTC | 2921499090 |
| SMILES | NCc1cc(Cl)ccc1F |
| InChI | InChI=1S/C7H7ClFN/c8-6-1-2-7(9)5(3-6)4-10/h1-3H,4,10H2 |
| InChI Key | BFLBLJKULFDOTN-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/6433_1_261723_26_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Chloro-2-fluorobenzoic acid | 394-30-9 | 2A-9006428 |
| 5-Chloro-2-fluorobenzonitrile | 57381-34-7 | 2A-9006429 |
| 5-Chloro-2-fluorobenzotrifluoride | 89634-74-2 | 2A-9006430 |
| 5-Chloro-2-fluorobenzoyl chloride | 394-29-6 | 2A-9006431 |
| 5-Chloro-2-fluorobenzyl bromide | 71916-91-1 | 2A-9006432 |
| 5-Chloro-2-fluoronitrobenzene | 345-18-6 | 2A-9006434 |
| 5-Chloro-2-fluorophenol | 186589-76-4 | 2A-9006435 |
| 5'-Chloro-2'-hydroxy-3'-nitroacetophenone | 84942-40-5 | 2A-9006439 |
| 5'-Chloro-2'-hydroxyacetophenone | 1450-74-4 | 2A-9006441 |
| 5-Chloro-2-hydroxybenzophenone | 85-19-8 | 2A-9006442 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA