
CAS Number1988-88-1
Synonyms<3,5-di(tert-butyl)>-4-hydroxybenzoic acid nitrile; 2,6-di-tert-butyl-4-cyanophenol; Benzonitrile,3,5-di-tert-butyl-4-hydroxy; 3,5-bis(tert-butyl)-4-hydroxybenzenecarbonitrile; 3,5-DI-TERT-BUTYL-4-HYDROXYBENZONITRILE; 4-hydroxy-3,5-di-tert-butylbenzonitrile; Benzonitrile,3,5-bis(1,1-dimethylethyl)-4-hydroxy; 2,6-di-t-butyl-4-cyanophenol; 3,5-Di(tert-butyl)-4-hydroxybenzonitrile; 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzonitrile; MFCD00156137
Molecular FormulaC15H21NO
Molecular Weight231.341
Density1.01g/cm3
Boiling Point311.2ºC at 760 mmHg
Melting Point144 °C
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1988-88-1 |
| Catalog No. | 2A-9064279 |
| Chinese Name | 3,5-二-叔-丁基-4-羟基苯甲腈 |
| Synonyms | <3,5-di(tert-butyl)>-4-hydroxybenzoic acid nitrile; 2,6-di-tert-butyl-4-cyanophenol; Benzonitrile,3,5-di-tert-butyl-4-hydroxy; 3,5-bis(tert-butyl)-4-hydroxybenzenecarbonitrile; 3,5-DI-TERT-BUTYL-4-HYDROXYBENZONITRILE; 4-hydroxy-3,5-di-tert-butylbenzonitrile; Benzonitrile,3,5-bis(1,1-dimethylethyl)-4-hydroxy; 2,6-di-t-butyl-4-cyanophenol; 3,5-Di(tert-butyl)-4-hydroxybenzonitrile; 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzonitrile; MFCD00156137 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.341 |
| Density | 1.01g/cm3 |
| Boiling Point | 311.2ºC at 760 mmHg |
| Melting Point | 144 °C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2926909090 |
| MDL Number | MFCD00156137 |
| SMILES | CC(C)(C)c1cc(C#N)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C15H21NO/c1-14(2,3)11-7-10(9-16)8-12(13(11)17)15(4,5)6/h7-8,17H,1-6H3 |
| InChI Key | AKXIIOLURNATOC-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/64279_1_1988_88_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cyclohexylidenecyanoacetic acid | 37107-50-9 | 2A-9064271 |
| 1-(4-Bromophenyl)-4-(4-methylphenyl)but-3-yn-1-ol | 852211-40-6 | 2A-9064272 |
| Ethyl 4-(allyloxy)-3,5-diiodobenzoate | 91446-76-3 | 2A-9064273 |
| 4-(Allyloxy)-3,5-diiodobenzamide | 90842-71-0 | 2A-9064275 |
| Diethyl benzoylmalonate | 1087-97-4 | 2A-9064278 |
| 2-Cyclopentene-1-malonic acid, diethyl ester | 53608-93-8 | 2A-9064280 |
| tert-Butyl 2-amino-2-methylpropylcarbamate | 95034-05-2 | 2A-9064281 |
| Ethyl 3-ethyl-4-hydroxy-2-methylbenzoate | 102395-98-2 | 2A-9064282 |
| Furazan, 3,4-dimethyl- | 4975-21-7 | 2A-9064283 |
| Ethyl 3-ethyl-2-methyl-4-propoxybenzoate | 92730-42-2 | 2A-9064284 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA