
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41727-45-1 |
| Catalog No. | 2A-9064266 |
| Chinese Name | 4-烯丙氧基-3,5-二氯-苯甲酸 |
| Synonyms | 4-Allyloxy-3,5-dichlorobenzoesaeure; 4-allyloxy-3,5-dichloro-benzoic acid; 3.5-Dichlor-4-allyloxybenzoesaeure |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.244 |
| Density | 1.388g/cm3 |
| Boiling Point | 363ºC at 760 mmHg |
| HTC | 2918990090 |
| MDL Number | MFCD01660233 |
| SMILES | C=CCOc1c(Cl)cc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C10H8Cl2O3/c1-2-3-15-9-7(11)4-6(10(13)14)5-8(9)12/h2,4-5H,1,3H2,(H,13,14) |
| InChI Key | RXLVKVUKUULKAK-UHFFFAOYSA-N |
| MSDS | msds/64266_1_41727_45_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(p-Fluorophenyl)-3-phenyl-2-propanone | 330-97-2 | 2A-9064261 |
| 1-Bromo-1,3-decadiyne | 959843-14-2 | 2A-9064262 |
| Allyl 4-(allyloxy)-3,5-dichlorobenzoate | 91954-47-1 | 2A-9064263 |
| 1-(p-Methylthiophenyl)-3-phenyl-2-propanone | 131516-77-3 | 2A-9064264 |
| 1-Methoxymethyl-1-phenylethane | 94073-86-6 | 2A-9064265 |
| 1-(p-Methoxyphenyl)-3-phenyl-2-propanone | 29917-69-9 | 2A-9064267 |
| 4-(Allyloxy)-3,5-dichlorobenzamide | 41727-53-1 | 2A-9064268 |
| 4-(Allyloxy)-3,5-diiodobenzoic acid | 91634-08-1 | 2A-9064270 |
| Cyclohexylidenecyanoacetic acid | 37107-50-9 | 2A-9064271 |
| 1-(4-Bromophenyl)-4-(4-methylphenyl)but-3-yn-1-ol | 852211-40-6 | 2A-9064272 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA