
CAS Number671-88-5
SynonymsDiuroblitz; 5-chloro-toluene-2,4-disulfonic acid diamide; Edemil; Desamide; Tolclotidum; Disulphamide; 5-Chlor-toluol-2,4-disulfonsaeure-diamid; Toluidrin; 6-Chlor-4-methyl-benzol-1,3-disulfonsaeurediamid; 5-Chlor-toluol-2,4-disulfonamid; Disamide; Toluren; Ethacrynic acid; Disulfamide; Fisiuretik
Molecular FormulaC7H9ClN2O4S2
Molecular Weight284.74
Density1.621g/cm3
Boiling Point549.4ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 671-88-5 |
| Catalog No. | 2A-9064168 |
| Chinese Name | 双胺磺氯苯 |
| Synonyms | Diuroblitz; 5-chloro-toluene-2,4-disulfonic acid diamide; Edemil; Desamide; Tolclotidum; Disulphamide; 5-Chlor-toluol-2,4-disulfonsaeure-diamid; Toluidrin; 6-Chlor-4-methyl-benzol-1,3-disulfonsaeurediamid; 5-Chlor-toluol-2,4-disulfonamid; Disamide; Toluren; Ethacrynic acid; Disulfamide; Fisiuretik |
| Molecular Formula | C7H9ClN2O4S2 |
| Molecular Weight | 284.74 |
| Density | 1.621g/cm3 |
| Boiling Point | 549.4ºC at 760 mmHg |
| Application | Disulfamide is an oral diuretic and carbonic anhydrase inhibitor with an IC50 value of 0.07 μM. Disulfonamides cause diuresis by inhibiting carbonic anhydrase and preventing the reabsorption of sodium |
| MDL Number | C7H9ClN2O4S2 |
| SMILES | Cc1cc(Cl)c(S(N)(=O)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C7H9ClN2O4S2/c1-4-2-5(8)7(16(10,13)14)3-6(4)15(9,11)12/h2-3H,1H3,(H2,9,11,12)(H2,10,13,14) |
| InChI Key | RCFKEIREOSXLET-UHFFFAOYSA-N |
| MSDS | msds/64168_1_671_88_5.pdf |
| Transport Info | Product Name: Disulfamide |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| a-Methoxyphenazine | 2876-17-7 | 2A-9064163 |
| (E)-1-Methyl-4-(1-phenylprop-1-en-1-yl)benzene | 4333-50-0 | 2A-9064164 |
| a-Hydroxyphenazine | 528-71-2 | 2A-9064165 |
| 4-Chloro-6-methylbenzene-1,3-disulfonyl dichloride | 13940-86-8 | 2A-9064166 |
| 2-Ammonio-2-(2-carboxyethyl)pent-4-enoate | 916505-64-1 | 2A-9064167 |
| 1-Phenylhex-5-en-3-amine | 17125-07-4 | 2A-9064169 |
| N1,N3-Diallyl-4-chloro-6-methylbenzene-1,3-disulfonamide | 100607-32-7 | 2A-9064173 |
| p-Bromophenylurea | 1967-25-5 | 2A-9064174 |
| 4-Chloro-N1,N3-diisobutyl-6-methylbenzene-1,3-disulfonamide | 101085-48-7 | 2A-9064175 |
| 2-Benzyl-3,3,3-trifluoro-1-phenylpropan-1-one | 808105-46-6 | 2A-9064176 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA