
CAS Number4538-50-5
Synonyms(R)-oxirane-2-carboxylic acid methyl ester; 2-Oxiranecarboxylicacid,methyl ester,(2S); methyl (R)-oxiranecarboxylate; Cucurbitaceae; Oxiranecarboxylic acid,methyl ester; Glycidic acid methyl ester; methyl (2R)-2,3-epoxypropanoate; methyl (R)-glycidate; methyl (2R)-glycidate; bitter cucumber; (2R)-methyl 2,3-epoxypropanoate; Methyl 2-oxiranecarboxylate
Molecular FormulaC4H6O3
Molecular Weight102.08900
Density1.246g/cm3
Boiling Point97.4ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4538-50-5 |
| Catalog No. | 2A-9064095 |
| Chinese Name | 2,3-环氧丙酸甲酯 |
| Synonyms | (R)-oxirane-2-carboxylic acid methyl ester; 2-Oxiranecarboxylicacid,methyl ester,(2S); methyl (R)-oxiranecarboxylate; Cucurbitaceae; Oxiranecarboxylic acid,methyl ester; Glycidic acid methyl ester; methyl (2R)-2,3-epoxypropanoate; methyl (R)-glycidate; methyl (2R)-glycidate; bitter cucumber; (2R)-methyl 2,3-epoxypropanoate; Methyl 2-oxiranecarboxylate |
| Molecular Formula | C4H6O3 |
| Molecular Weight | 102.08900 |
| Density | 1.246g/cm3 |
| Boiling Point | 97.4ºC at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2918990090 |
| SMILES | COC(=O)C1CO1 |
| InChI | InChI=1S/C4H6O3/c1-6-4(5)3-2-7-3/h3H,2H2,1H3 |
| InChI Key | YKNYRRVISWJDSR-UHFFFAOYSA-N |
| MSDS | msds/64095_1_4538_50_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4-(4-Chlorophenyl)-4-hydroxypiperidin-1-yl)-1-phenylbutan-1-one | 31293-71-7 | 2A-9064087 |
| 1-(4-Fluorophenyl)-4-(4-hydroxy-4-phenylpiperidin-1-yl)butan-1-one | 3109-12-4 | 2A-9064090 |
| Benzene, 1-methoxy-2-phenoxy- | 1695-04-1 | 2A-9064091 |
| 2-methoxy-4'-methyldiphenyl ether | 3402-84-4 | 2A-9064093 |
| 1-(4-Fluorophenyl)-4-(4-hydroxy-4-p-tolylpiperidin-1-yl)butan-1-one | 1050-79-9 | 2A-9064094 |
| 2-methoxy-5-methyldiphenyl ether | 135896-46-7 | 2A-9064096 |
| 1-(4-Fluorophenyl)-4-(4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl)butan-1-one | 803-45-2 | 2A-9064097 |
| 1-Phenylbut-3-en-1-amine | 4383-23-7 | 2A-9064098 |
| 1-(4-Nitrophenyl)but-3-en-1-amine | 354122-73-9 | 2A-9064102 |
| 2-(2-(2,5-Dimethyl-1H-pyrrol-1-yl)phenoxy)-N,N-dimethylethanamine | 97020-28-5 | 2A-9064103 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA