
CAS Number14966-36-0
Synonymsacenaphthen-1-yl acetate; acetyl acenaphthenol; acetic acid acenaphthen-1-yl ester; 1-ACETOXYACENAPHTHENE; 1-acenaphthyl acetate; Essigsaeure-acenaphthen-1-ylester; acenaphthenyl acetate; MFCD00173922; 1,2-Dihydroacenaphthylen-1-yl acetate
Molecular FormulaC14H12O2
Molecular Weight212.24
Density1.21 g/cm3
Boiling Point166-168ºC 5mm
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14966-36-0 |
| Catalog No. | 2A-9064015 |
| Chinese Name | 1-乙酰氧基二氢苊 |
| Synonyms | acenaphthen-1-yl acetate; acetyl acenaphthenol; acetic acid acenaphthen-1-yl ester; 1-ACETOXYACENAPHTHENE; 1-acenaphthyl acetate; Essigsaeure-acenaphthen-1-ylester; acenaphthenyl acetate; MFCD00173922; 1,2-Dihydroacenaphthylen-1-yl acetate |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24 |
| Density | 1.21 g/cm3 |
| Boiling Point | 166-168ºC 5mm |
| Appearance | solid |
| Storage Condition | Sealed at room temperature, protected from light, |
| HTC | 2915390090 |
| PubChem ID | 329827525 |
| MDL Number | MFCD00173922 |
| SMILES | CC(OC1CC2=CC=CC3=C2C1=CC=C3)=O |
| InChI | 1S/C14H12O2/c1-9(15)16-13-8-11-6-2-4-10-5-3-7-12(13)14(10)11/h2-7,13H,8H2,1H3 |
| InChI Key | UYSIEGCCYVPJLE-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/64015_1_14966_36_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Fluoro-4-(p-tolyloxy)benzene | 42917-43-1 | 2A-9064010 |
| Uramil | 118-78-5 | 2A-9064011 |
| 1-(4-Fluorophenoxy)-2-methylbenzene | 431047-37-9 | 2A-9064012 |
| 1-(2-(4-Fluorophenoxy)phenyl)ethanone | 431047-38-0 | 2A-9064013 |
| 1-Acenaphthenol | 6306-07-6 | 2A-9064014 |
| 4,4'-Oxybis(methoxybenzene) | 1655-74-9 | 2A-9064016 |
| Acenaphthenebutyric acid, g-oxo | 856076-05-6 | 2A-9064017 |
| 1-(4-Methoxyphenoxy)-2-methylbenzene | 223655-23-0 | 2A-9064018 |
| 1-Acetylcyclohexene | 932-66-1 | 2A-9064020 |
| 1-Chloro-4-(2,2-dichloro-1-methylvinyl)benzene | 73644-88-9 | 2A-9064021 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA