
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35114-93-3 |
| Catalog No. | 2A-9064007 |
| Chinese Name | 1-[4-(4-氟苯氧基)苯基]乙酮 |
| Synonyms | 4-acetyl-4'-fluorodiphenylether; 4-fluorophenyl 4-acetylphenyl ether; 1-[4-(4-Fluorophenoxy)phenyl]ethanone; PC4228 |
| Molecular Formula | C14H11FO2 |
| Molecular Weight | 230.241 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 332.7±27.0 °C at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2914700090 |
| MDL Number | MFCD02246922 |
| SMILES | CC(=O)c1ccc(Oc2ccc(F)cc2)cc1 |
| InChI Key | HPLGELQKWAOYKR-UHFFFAOYSA-N |
| MSDS | msds/64007_1_35114_93_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Tricarbomethoxymethane | 1186-73-8 | 2A-9064002 |
| Benzene, 1-methoxy-2-(4-methoxyphenoxy)- | 1655-72-7 | 2A-9064003 |
| Benzene, 1,2,3-triiodo-5-nitro- | 53663-23-3 | 2A-9064004 |
| 1-Fluoro-4-(4-methoxyphenoxy)benzene | 26129-34-0 | 2A-9064005 |
| 4-(4-Fluorophenoxy)benzonitrile | 215589-24-5 | 2A-9064006 |
| 4-(4-Fluorophenoxy)-N,N-dimethylaniline | 38695-10-2 | 2A-9064008 |
| 1-Fluoro-4-(p-tolyloxy)benzene | 42917-43-1 | 2A-9064010 |
| Uramil | 118-78-5 | 2A-9064011 |
| 1-(4-Fluorophenoxy)-2-methylbenzene | 431047-37-9 | 2A-9064012 |
| 1-(2-(4-Fluorophenoxy)phenyl)ethanone | 431047-38-0 | 2A-9064013 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA