
CAS Number603-71-4
Synonyms1,3,5-trimethyl-2-nitro-benzene; nitromesitylene; 2-nitromesitylene; Mesitylene,2-nitro; MFCD00007170; 2-nitro-1,3,5-trimethylbenzene; EINECS 210-054-9; 1-nitro-2,4,6-tri-methyl benzene; 1,3,5-Trimethyl-2-nitro-benzol; Benzene,1,3,5-trimethyl-2-nitro; Mononitromesitylene
Molecular FormulaC9H11NO2
Molecular Weight165.19
Density1.1g/cm3
Boiling Point255 °C(lit.)
Melting Point41-44 °C(lit.)
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 603-71-4 |
| Catalog No. | 2A-9063975 |
| Chinese Name | 1,3,5-三甲基-2-硝基苯 |
| Synonyms | 1,3,5-trimethyl-2-nitro-benzene; nitromesitylene; 2-nitromesitylene; Mesitylene,2-nitro; MFCD00007170; 2-nitro-1,3,5-trimethylbenzene; EINECS 210-054-9; 1-nitro-2,4,6-tri-methyl benzene; 1,3,5-Trimethyl-2-nitro-benzol; Benzene,1,3,5-trimethyl-2-nitro; Mononitromesitylene |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 |
| Density | 1.1g/cm3 |
| Boiling Point | 255 °C(lit.) |
| Melting Point | 41-44 °C(lit.) |
| Storage Condition | Storage: Seal the container and store it in a seal |
| Packaging | III |
| HTC | 2904209090 |
| MDL Number | MFCD00007170 |
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C9H11NO2/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3 |
| InChI Key | SCEKDQTVGHRSNS-UHFFFAOYSA-N |
| Hazard Symbols | 4.1 |
| MSDS | msds/63975_1_603_71_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2904209090 derivatives containing only nitro or only nitroso groups. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Cyclopentylacetophenone | 23033-65-0 | 2A-9063970 |
| 2-(5,5-Dimethyl-1,2,3-dioxaborinan-2-yl)benzoic acid ethyl ester | 346656-34-6 | 2A-9063971 |
| 1,2-Naphthoquinone | 524-42-5 | 2A-9063972 |
| Naphthalene, 2-(chloromercuri)- | 39966-41-1 | 2A-9063973 |
| "1,4:5,8-Dimethano-1,4,4a,5,8,8a,9a,10a-octahydroanthracene-9,10- | 78548-82-0 | 2A-9063974 |
| 2-Naphthol, 1-nitro- | 550-60-7 | 2A-9063976 |
| 1,4:5,8-Dimethanododecahydroanthracene-9,10-dione | 2065-48-7 | 2A-9063977 |
| 1,4:5,8-Dimethano-1,2,3,4,5,6,7,8-octahydroanthracene-9,10-diol | 130778-68-6 | 2A-9063978 |
| 1,4:5,8-Dimethano-1,2,3,4,5,6,7,8-octahydro-9,10-dimethoxyanthracene | 322733-47-1 | 2A-9063979 |
| N-(2,2-Diethoxy)ethyl formamide | 53089-10-4 | 2A-9063980 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA