CAS Number693-55-0
SynonymsSebacic acid 1-ethyl ester; Sebacicacidmonoethylester; EINECS 211-753-1; DECANEDIOIC ACID MONOETHYL ESTER; 10-ethoxy-10-oxodecanoic acid; Decanedioic acid 1-ethyl ester; sebasic monoethyl ester; monoethyl sebacate; 10-ethoxy-10-keto-capric acid; MFCD00014387; Sebacicaci
Molecular FormulaC12H22O4
Molecular Weight230.307
Density1.024 g/cm3
Boiling Point336ºC at 760 mmHg
Melting Point35-38ºC
Appearancewhite solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 693-55-0 |
| Catalog No. | 2A-9063953 |
| Chinese Name | 癸二酸氢乙酯 |
| Synonyms | Sebacic acid 1-ethyl ester; Sebacicacidmonoethylester; EINECS 211-753-1; DECANEDIOIC ACID MONOETHYL ESTER; 10-ethoxy-10-oxodecanoic acid; Decanedioic acid 1-ethyl ester; sebasic monoethyl ester; monoethyl sebacate; 10-ethoxy-10-keto-capric acid; MFCD00014387; Sebacicaci |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.307 |
| Density | 1.024 g/cm3 |
| Boiling Point | 336ºC at 760 mmHg |
| Melting Point | 35-38ºC |
| Appearance | white solid |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2918990090 |
| MDL Number | MFCD00014387 |
| SMILES | CCOC(=O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H22O4/c1-2-16-12(15)10-8-6-4-3-5-7-9-11(13)14/h2-10H2,1H3,(H,13,14) |
| InChI Key | DLZCDMPHHUODDO-UHFFFAOYSA-N |
| MSDS | msds/63953_1_693_55_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Iodo-1-heptyne | 54573-13-6 | 2A-9063947 |
| Isobutyric acid, a-benzoyl-, ethyl ester | 25491-42-3 | 2A-9063948 |
| (Z)-1-Iodo-1-heptene | 63318-29-6 | 2A-9063949 |
| (Z)-1-(1-Heptenyl)-1,1-dimethylsilanol | 261717-40-2 | 2A-9063950 |
| (Z)-1-(1-Heptenyl)-4-methoxybenzene | 80638-85-3 | 2A-9063952 |
| (E)-1-(1-Heptenyl)-4-methoxybenzene | 135987-61-0 | 2A-9063954 |
| Carbamic acid, methyl-, ethyl ester | 105-40-8 | 2A-9063955 |
| (E)-2-Methyl-3-phenylacrylic acid butyl ester | 21511-00-5 | 2A-9063956 |
| (E)-4-(2-Phenylethenyl)benzonitrile | 13041-79-7 | 2A-9063957 |
| 1-Naphthoic acid, ethyl ester | 3007-97-4 | 2A-9063958 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS