
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54966-52-8 |
| Catalog No. | 2A-9063873 |
| Chinese Name | ethyl 4-cyclohexyl-4-oxobutanoate |
| Synonyms | ETHYL 4-CYCLOHEXYL-4-OXOBUTYRATE; 4-cyclohexyl-4-oxo-butyric acid ethyl ester |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.28500 |
| Density | 1.024g/cm3 |
| Boiling Point | 309.6ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2918300090 |
| MDL Number | MFCD19351467 |
| SMILES | Nc1ccc(cc1)C(=O)CCC(=O)OCC |
| InChI Key | ZFHSICJRFPJEIS-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/63873_1_54966_52_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzenearsonic acid, p-hydroxy-, sodium salt | 53663-20-0 | 2A-9063865 |
| 2-(Hex-1-en-2-yl)cyclobutanone | 106987-99-9 | 2A-9063867 |
| 2-Phenylcyclobutanone | 42436-86-2 | 2A-9063868 |
| (E)-2-Styrylcyclobutanone | 130719-19-6 | 2A-9063869 |
| 2-Hexylcyclobutanone | 35493-43-7 | 2A-9063871 |
| 3-Hydroxy-2-phenylcyclopent-2-enone | 5864-79-9 | 2A-9063874 |
| 3-Hydroxy-2-nonylcyclopent-2-enone | 88441-36-5 | 2A-9063875 |
| 2,2-Diethylcyclopentane-1,3-dione | 62248-57-1 | 2A-9063876 |
| Methyl 5-ethyl-4-oxoheptanoate | 65213-30-1 | 2A-9063877 |
| Methyl 4-(4-tert-butylcyclohexyl)-4-oxobutanoate | 65213-31-2 | 2A-9063878 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA