
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 537-47-3 |
| Catalog No. | 2A-9063864 |
| Chinese Name | 4-苯基氨基脲 |
| Synonyms | 1-amino-3-phenylurea; MFCD00007590; 4-PhenylseMicarbazide; EINECS 208-669-2 |
| Molecular Formula | C7H9O1N3 |
| Molecular Weight | 151.17 |
| Density | 1.275 g/cm3 |
| Melting Point | 122-125 °C(lit.) |
| Appearance | White to orange powder, crystalline powder and/or chunks |
| Storage Condition | Store in a cool, dry, well-ventilated warehouse. K |
| HTC | 2928000090 |
| MDL Number | MFCD00007590 |
| SMILES | NNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C7H9N3O/c8-10-7(11)9-6-4-2-1-3-5-6/h1-5H,8H2,(H2,9,10,11) |
| InChI Key | MOCKWYUCPREFCZ-UHFFFAOYSA-N |
| MSDS | msds/63864_1_537_47_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Methyl 3,4-dimethoxy-5,6,7,8-tetrahydronaphthalene-2-carboxylate | 89228-43-3 | 2A-9063836 |
| 2-(1-Methylcyclohex-2-enyl)acetaldehyde | 60415-75-0 | 2A-9063846 |
| 2-(2-Methylfuran-3-yl)acetaldehyde | 27394-15-6 | 2A-9063847 |
| Spiro[3.5]non-5-en-1-one | 41597-04-0 | 2A-9063851 |
| 1,1,2,3-Propanetetracarboxylic acid, tetraethyl ester | 635-03-0 | 2A-9063860 |
| Spiro[3.5]nonan-1-one | 29800-45-1 | 2A-9063870 |
| Spiro[4.5]decane-1,4-dione | 39984-92-4 | 2A-9063872 |
| 9,9-Dimethylspiro[4.5]decan-7-one | 63858-64-0 | 2A-9063902 |
| Spiro[4.5]decan-7-one | 62788-60-7 | 2A-9063903 |
| 6-Methylspiro[4.5]decan-7-one | 113163-13-6 | 2A-9063904 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA