CAS Number2052-06-4
Synonyms4-bromo-N,N-diethylbenzenamine; 4-bromo-N,N-diethylbenzeneamine; p-N,Nddiethylaniline; P-BROMO-N,N-DIETHYLANILINE; N,N-diethyl-p-bromoaniline; EINECS 218-140-8; MFCD00013530; 4-Bromo-N,N-diethylaniline
Molecular FormulaC10H14BrN
Molecular Weight228.12900
Density1.291g/cm3
Boiling Point269-271°C
Melting Point32-33 °C(lit.)
AppearanceWhite-light yellow crystal-massive solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2052-06-4 |
| Catalog No. | 2A-9063726 |
| Chinese Name | 4-溴-N,N-二乙基苯胺 |
| Synonyms | 4-bromo-N,N-diethylbenzenamine; 4-bromo-N,N-diethylbenzeneamine; p-N,Nddiethylaniline; P-BROMO-N,N-DIETHYLANILINE; N,N-diethyl-p-bromoaniline; EINECS 218-140-8; MFCD00013530; 4-Bromo-N,N-diethylaniline |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.12900 |
| Density | 1.291g/cm3 |
| Boiling Point | 269-271°C |
| Melting Point | 32-33 °C(lit.) |
| Appearance | White-light yellow crystal-massive solid |
| Storage Condition | Keep the receptacle sealed and stored in a cool, d |
| Packaging | III |
| HTC | 2921420090 |
| SMILES | CCN(CC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H14BrN/c1-3-12(4-2)10-7-5-9(11)6-8-10/h5-8H,3-4H2,1-2H3 |
| InChI Key | NGYMZFJVHHKJQR-UHFFFAOYSA-N |
| MSDS | msds/63726_1_2052_06_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 4-Bromo-N,N-diethylaniline Modification number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 9H-Fluorene, 9-chloro-9-phenyl- | 25022-99-5 | 2A-9063719 |
| 9H-Fluorene, 9-iodo-9-phenyl- | 73207-97-3 | 2A-9063720 |
| Ethanone, 2,2-dibromo-1-(6-methoxy-2-naphthalenyl)- | 52997-56-5 | 2A-9063722 |
| Benzenamine, 4-bromo-N,2-dimethyl- | 59557-89-0 | 2A-9063724 |
| Benzenamine, 4-bromo-N,N,2-trimethyl- | 50638-49-8 | 2A-9063725 |
| Benzenamine, 4-bromo-N,N-diethyl-2-methyl- | 81090-38-2 | 2A-9063727 |
| Benzenamine, 4-bromo-N,N,3-trimethyl- | 50638-50-1 | 2A-9063728 |
| Benzenamine, 4-bromo-2,3-dimethyl- | 22364-25-6 | 2A-9063729 |
| Benzenamine, 4-bromo-2,5-dimethyl- | 30273-40-6 | 2A-9063730 |
| Benzenamine, 4-bromo-3,5-dimethyl- | 59557-90-3 | 2A-9063731 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS