
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 74929-23-0 |
| Catalog No. | 2A-9063698 |
| Chinese Name | 2-PROPYNAL, 3-(4-FLUOROPHENYL) |
| Molecular Formula | C9H6N2Br1S1F1 |
| Molecular Weight | 148.13400 |
| HTC | 2913000090 |
| MDL Number | MFCD03424578 |
| SMILES | Fc1c(cc(cc1)c2nc([s]c2)N)Br |
| InChI | 1S/C9H6BrFN2S/c10-6-3-5(1-2-7(6)11)8-4-14-9(12)13-8/h1-4H,(H2,12,13) |
| InChI Key | DUJCJNOITOUHLQ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352116 |
| MSDS | msds/63698_1_74929_23_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Butanal, 2,2-dimethyl- | 2094-75-9 | 2A-9063682 |
| Hexanal, 2,2-dimethyl- | 996-12-3 | 2A-9063683 |
| Pentanal, 2,2,4-trimethyl- | 70027-95-1 | 2A-9063684 |
| 2-Propynal, 3-(4-chlorophenyl)- | 67228-76-6 | 2A-9063696 |
| 2-Propynal, 3-(4-bromophenyl)- | 76457-91-5 | 2A-9063697 |
| 2-Propynal, 3-(4-methoxyphenyl)- | 90696-21-2 | 2A-9063700 |
| Octanenitrile, 8-oxo- | 13050-09-4 | 2A-9063712 |
| Heptanenitrile, 7-oxo- | 18214-15-8 | 2A-9063713 |
| Propane, 1,3-diiodo-2,2-dimethyl- | 66688-49-1 | 2A-9063718 |
| 9H-Fluorene, 9-chloro-9-phenyl- | 25022-99-5 | 2A-9063719 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA