
CAS Number1561-86-0
SynonymsCyclohexene Chlorohydrin; EINECS 216-339-4; 2-chlorocyclohexan-1-ol; 2-Chlorocyclohexanol; MFCD00003860
Molecular FormulaC18H25ClN2O5
Molecular Weight384.863
Density1.13 g/mL at 25 °C(lit.)
Boiling Point88-90°C 20mm
Melting Point23°C(凝固点)
AppearanceTransparent colorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1561-86-0 |
| Catalog No. | 2A-9063644 |
| Chinese Name | 2-氯环己醇 |
| Synonyms | Cyclohexene Chlorohydrin; EINECS 216-339-4; 2-chlorocyclohexan-1-ol; 2-Chlorocyclohexanol; MFCD00003860 |
| Molecular Formula | C18H25ClN2O5 |
| Molecular Weight | 384.863 |
| Density | 1.13 g/mL at 25 °C(lit.) |
| Boiling Point | 88-90°C 20mm |
| Melting Point | 23°C(凝固点) |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2906199090 |
| MDL Number | MFCD04119789 |
| SMILES | OC1CCCCC1Cl |
| InChI | InChI=1S/C6H11ClO/c7-5-3-1-2-4-6(5)8/h5-6,8H,1-4H2 |
| InChI Key | NYEWDMNOXFGGDX-UHFFFAOYSA-N |
| MSDS | msds/63644_1_1561_86_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Butanone, 4-(4-methylphenyl)- | 7774-79-0 | 2A-9063638 |
| N-Benzyl-2-methoxyaniline | 50798-94-2 | 2A-9063639 |
| Benzenepropanoic acid, 4-methyl-, ethyl ester | 7116-41-8 | 2A-9063641 |
| Benzenepropanoic acid, 4-fluoro-, ethyl ester | 7116-38-3 | 2A-9063642 |
| Benzenepropanoic acid, 4-methoxy-, ethyl ester | 22767-72-2 | 2A-9063643 |
| Phenol, o-chloromercuri- | 90-03-9 | 2A-9063646 |
| 1-Fluoro-2-isothiocyanatobenzene | 38985-64-7 | 2A-9063648 |
| 1-Chloro-2-isothiocyanatobenzene | 2740-81-0 | 2A-9063649 |
| 1-Isothiocyanato-2-methoxybenzene | 3288-04-8 | 2A-9063650 |
| 1-Fluoro-3-isothiocyanatobenzene | 404-72-8 | 2A-9063651 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA