
CAS Number3506-36-3
Synonyms1-phenyl-3-(N,N-dimethylamino)propan-1-one; 2-Benzylethyldimethylamine; 3-dimethylamino-1-phenylpropan-1-one; |A-dimethylaminopropiophenone; 3-dimethylamino-1-phenyl-1-propanone; 3-dimethylamino-propiophenone; 1-phenyl-3-(N,N-dimethylamino)-1-propanone; Propiophenone,3-(dimethylamino)
Molecular FormulaC11H15NO
Molecular Weight177.248
Density0.997g/cm3
Boiling Point267.5ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3506-36-3 |
| Catalog No. | 2A-9063588 |
| Chinese Name | 3-(二甲氨基)苯丙酮盐酸盐 |
| Synonyms | 1-phenyl-3-(N,N-dimethylamino)propan-1-one; 2-Benzylethyldimethylamine; 3-dimethylamino-1-phenylpropan-1-one; |A-dimethylaminopropiophenone; 3-dimethylamino-1-phenyl-1-propanone; 3-dimethylamino-propiophenone; 1-phenyl-3-(N,N-dimethylamino)-1-propanone; Propiophenone,3-(dimethylamino) |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.248 |
| Density | 0.997g/cm3 |
| Boiling Point | 267.5ºC at 760mmHg |
| HTC | 2922399090 |
| MDL Number | MFCD00100910 |
| SMILES | CN(C)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO/c1-12(2)9-8-11(13)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChI Key | QMNXJNURJISYMS-UHFFFAOYSA-N |
| MSDS | msds/63588_1_3506_36_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (E)-N-(4-Chlorobenzylidene)aniline | 1613-95-2 | 2A-9063581 |
| 4-(1,3-Dioxoisoindolin-2-yl)butanoic acid | 3130-75-4 | 2A-9063582 |
| 3,3'-Dimethoxybiphenyl | 6161-50-8 | 2A-9063583 |
| (E)-N-(3-Chlorobenzylidene)aniline | 32347-04-9 | 2A-9063585 |
| 2-Naphthoic acid, 3,4-dihydro-6,7-dimethoxy- | 53684-50-7 | 2A-9063586 |
| 3,5-Dimethyl-4-carbethoxy-2-cyclohexen-1-one | 6102-15-4 | 2A-9063590 |
| 2,5-Dimethylmandelic acid | 5766-40-5 | 2A-9063592 |
| 2,5-Dinitrobenzoic acid | 610-28-6 | 2A-9063598 |
| Naphthalene, 1,4-dinitro- | 6921-26-2 | 2A-9063599 |
| Indone, 2,3-diphenyl- | 1801-42-9 | 2A-9063600 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA