
CAS Number2039-83-0
Synonyms1,2-Dichloro-4-vinylbenzene; 3,4-dichlorophenylethylene; 1,2-dichloro-4-ethenyl-benzene; 3,4-Dichlor-styrol; Benzene,1,2-dichloro-4-ethenyl; EINECS 218-023-1; 3,4-dichlorostyrene
Molecular FormulaC8H6Cl2
Molecular Weight173.04
Density1.2±0.1 g/cm3
Boiling Point238.9±28.0 °C at 760 mmHg
AppearanceTransparent colorless to yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2039-83-0 |
| Catalog No. | 2A-9063507 |
| Chinese Name | 3,4-二氯苯乙烯 |
| Synonyms | 1,2-Dichloro-4-vinylbenzene; 3,4-dichlorophenylethylene; 1,2-dichloro-4-ethenyl-benzene; 3,4-Dichlor-styrol; Benzene,1,2-dichloro-4-ethenyl; EINECS 218-023-1; 3,4-dichlorostyrene |
| Molecular Formula | C8H6Cl2 |
| Molecular Weight | 173.04 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 238.9±28.0 °C at 760 mmHg |
| Appearance | Transparent colorless to yellow liquid |
| Storage Condition | 2-8°C |
| HTC | 2903999090 |
| MDL Number | MFCD00013625 |
| SMILES | C=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H6Cl2/c1-2-6-3-4-7(9)8(10)5-6/h2-5H,1H2 |
| InChI Key | BJQFWAQRPATHTR-UHFFFAOYSA-N |
| MSDS | msds/63507_1_2039_83_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cyclohexanone, 2-(1,1-dimethylpropyl)- | 5441-54-3 | 2A-9063494 |
| Cycloheptanone, 2-(1,1-dimethylethyl)- | 24301-21-1 | 2A-9063499 |
| 2,3-Dichlorostyrene | 2123-28-6 | 2A-9063501 |
| Cycloheptanone, 2-(1-methylethyl)- | 20036-72-0 | 2A-9063504 |
| 4,4'-Oxybis(1,3-dibromobenzene) | 5436-43-1 | 2A-9063505 |
| 2-Cyclopenten-1-one, 2-bromo- | 10481-34-2 | 2A-9063508 |
| 2,6-Dichlorostyrene | 28469-92-3 | 2A-9063510 |
| 1-(3-(Trifluoromethoxy)phenyl)hydrazine | 650628-49-2 | 2A-9063512 |
| 3,5-Dichlorostyrene | 2155-42-2 | 2A-9063513 |
| (±)-Eriodictyol | 4049-38-1 | 2A-9063517 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA