
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 70978-54-0 |
| Catalog No. | 2A-9006348 |
| Chinese Name | 5'-溴-2'-羟基-3'-硝基乙酰苯 |
| Synonyms | 1-(5-bromo-2-hydroxy-3-nitrophenyl)ethanone; MFCD01631134 |
| Molecular Formula | BrC6H2(NO2)(OH)COCH3 |
| Molecular Weight | 260.04 |
| Purity | 97 |
| Density | 1.763g/cm3 |
| Boiling Point | 272.9ºC at 760 mmHg |
| Melting Point | 129-132 °C (lit.) |
| Storage Condition | Store in a sealed container in a cool, dry place. |
| HTC | 2914700090 |
| PubChem ID | 24878019 |
| MDL Number | MFCD01631134 |
| SMILES | CC(=O)c1cc(Br)cc(c1O)[N+]([O-])=O |
| InChI | 1S/C8H6BrNO4/c1-4(11)6-2-5(9)3-7(8(6)12)10(13)14/h2-3,12H,1H3 |
| InChI Key | CLNIBJASCGZXHH-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26-36 |
| MSDS | msds/6348_1_70978_54_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Bromo-2-fluorobenzotrifluoride | 393-37-3 | 2A-9006336 |
| 5-Bromo-2-fluorobenzyl alcohol | 99725-13-0 | 2A-9006337 |
| 5-Bromo-2-fluorobenzylisocyanide | 730964-48-4 | 2A-9006338 |
| 5-Bromo-2-fluorocinnamic acid | 202865-71-2 | 2A-9006339 |
| 5-Bromo-2-fluorophenol | 112204-58-7 | 2A-9006340 |
| 5-Bromo-2-hydroxybenzonitrile | 40530-18-5 | 2A-9006350 |
| 5-Bromo-2-hydroxynicotinic acid | 104612-36-4 | 2A-9006352 |
| 5'-Bromo-2'-hydroxypropiophenone | 17764-93-1 | 2A-9006353 |
| 5-Bromo-2-iodobenzoic acid | 21740-00-1 | 2A-9006357 |
| 5-Bromo-2-iodobenzotrifluoride | 364-12-5 | 2A-9006358 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA