CAS Number2881-63-2
Synonymsethyl p-chlorobenzoyl-acetate; 4-chlorobenzoylacetic acid ethyl ester; 3-(4-chlorophenyl)-3-oxopropionic acid ethyl ester; Benzenepropanoic acid, 4-chloro-β-oxo-, ethyl ester; Ethyl 3-(4-chlorophenyl)-3-oxopropanoate; Ethyl 3-(4-chlorophenyl)-3-oxo-propionate; ethyl 3-(4-Chloro-phenyl)-3-oxopropanoate; MFCD00018713; 3-oxo-3-(4-chlorophenyl)propionic acid ethyl ester; ethyl 4-chlorobenzoylacetate
Molecular FormulaClC6H4COCH2CO2C2H5
Molecular Weight226.66
Purity98%
Density1.2±0.1 g/cm3
Boiling Point268-269 °C (lit.)
Melting Point268-269°C
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2881-63-2 |
| Catalog No. | 2A-9063427 |
| Chinese Name | 3-(4-氯苯基)-3-氧-丙酸乙酯 |
| Synonyms | ethyl p-chlorobenzoyl-acetate; 4-chlorobenzoylacetic acid ethyl ester; 3-(4-chlorophenyl)-3-oxopropionic acid ethyl ester; Benzenepropanoic acid, 4-chloro-β-oxo-, ethyl ester; Ethyl 3-(4-chlorophenyl)-3-oxopropanoate; Ethyl 3-(4-chlorophenyl)-3-oxo-propionate; ethyl 3-(4-Chloro-phenyl)-3-oxopropanoate; MFCD00018713; 3-oxo-3-(4-chlorophenyl)propionic acid ethyl ester; ethyl 4-chlorobenzoylacetate |
| Molecular Formula | ClC6H4COCH2CO2C2H5 |
| Molecular Weight | 226.66 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 268-269 °C (lit.) |
| Melting Point | 268-269°C |
| Appearance | solid |
| Storage Condition | Store at room temperature in a cool and ventilated |
| HTC | 2918300090 |
| PubChem ID | 24879805 |
| MDL Number | MFCD00018713 |
| SMILES | CCOC(=O)CC(=O)c1ccc(Cl)cc1 |
| InChI | 1S/C11H11ClO3/c1-2-15-11(14)7-10(13)8-3-5-9(12)6-4-8/h3-6H,2,7H2,1H3 |
| InChI Key | DGCZHKABHPDNCC-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/63427_1_2881_63_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Pentenoic acid, 4-methyl-3-oxo-, ethyl ester | 25556-50-7 | 2A-9063419 |
| 4-Hexenoic acid, 3-oxo-, ethyl ester | 17544-47-7 | 2A-9063420 |
| 5-Fluoropyridin-2-amine | 152043-90-3 | 2A-9063421 |
| Benzenepropanoic acid, 4-methoxy-.beta.-oxo-, ethyl ester | 2881-83-6 | 2A-9063424 |
| Dimethyl-2-methoxymalonate | 5018-30-4 | 2A-9063425 |
| 2-Cyclobuten-1-one, 3-butyl- | 38425-48-8 | 2A-9063428 |
| 2-Bromo-4-tertbutylphenol | 2198-66-5 | 2A-9063429 |
| 2-Cyclobuten-1-one, 3-propyl- | 89711-20-6 | 2A-9063431 |
| 2-Cyclopenten-1-one, 2,5-dimethyl-3-phenyl- | 36461-43-5 | 2A-9063434 |
| Phenol,4-(2-methyl-1,3-dioxan-2-yl)- | 153332-89-9 | 2A-9063437 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS